Methyl 3,5-dichloro-4-fluorobenzoate
CAS No.:
1214375-18-4
M. Wt:
223.02
M. Fa:
C8H5Cl2FO2
InChI Key:
TVBFNISLGKFSNX-UHFFFAOYSA-N
Names and Identifiers of Methyl 3,5-dichloro-4-fluorobenzoate
CAS Number |
1214375-18-4 |
|---|---|
MDL Number |
MFCD12406866 |
IUPAC Name |
methyl 3,5-dichloro-4-fluorobenzoate |
InChI |
InChI=1S/C8H5Cl2FO2/c1-13-8(12)4-2-5(9)7(11)6(10)3-4/h2-3H,1H3 |
InChIKey |
TVBFNISLGKFSNX-UHFFFAOYSA-N |
Canonical SMILES |
COC(=O)C1=CC(=C(C(=C1)Cl)F)Cl |
UNSPSC Code |
12352100 |
Physical and chemical properties of Methyl 3,5-dichloro-4-fluorobenzoate
Boiling Point |
282.0±35.0 °C(Predicted) |
|---|---|
Density |
1.434±0.06 g/cm3(Predicted) |
H Bond Acceptors |
1 |
H Bond Donors |
0 |
LogP |
3.327514069 |
Molecular Formula |
C8H5Cl2FO2 |
Molecular Weight |
223.02 |
Safety Information of Methyl 3,5-dichloro-4-fluorobenzoate
Applications of Methyl 3,5-dichloro-4-fluorobenzoate
Methyl 3,5-dichloro-4-fluorobenzoate finds applications in various fields:
- Pharmaceuticals: It serves as an intermediate in the synthesis of biologically active compounds.
- Agricultural Chemicals: The compound may be utilized in the development of agrochemicals due to its biological activity.
- Material Science: It can be incorporated into polymer formulations or coatings due to its unique chemical properties.
Interaction Studies of Methyl 3,5-dichloro-4-fluorobenzoate
Studies have indicated that methyl 3,5-dichloro-4-fluorobenzoate interacts with various proteins and enzymes, influencing their structure and function. This interaction can lead to significant changes in metabolic pathways, making it a compound of interest for further research in pharmacology and toxicology.
