Sodium 3-(oxetan-2-yl)propanoate
Names and Identifiers of Sodium 3-(oxetan-2-yl)propanoate
CAS Number |
1955560-80-1 |
|---|---|
IUPAC Name |
sodium;3-(oxetan-2-yl)propanoate |
InChI |
InChI=1S/C6H10O3.Na/c7-6(8)2-1-5-3-4-9-5;/h5H,1-4H2,(H,7,8);/q;+1/p-1 |
InChIKey |
YGQVHRWSULNDRG-UHFFFAOYSA-M |
Canonical SMILES |
C1COC1CCC(=O)[O-].[Na+] |
Physical and chemical properties of Sodium 3-(oxetan-2-yl)propanoate
Molecular Formula |
C6H9NaO3 |
|---|---|
Molecular Weight |
152.12 |
Safety Information of Sodium 3-(oxetan-2-yl)propanoate
Applications of Sodium 3-(oxetan-2-yl)propanoate
Sodium 3-(oxetan-2-yl)propanoate serves various purposes across different fields:
- Organic Synthesis: It acts as a building block in synthesizing complex molecules due to its unique structural features.
- Medicinal Chemistry: Its potential biological activities make it a candidate for drug development, particularly in enhancing drug stability and efficacy.
- Material Science: The compound's reactivity allows for its use in developing new materials and polymers with specialized properties.
Interaction Studies of Sodium 3-(oxetan-2-yl)propanoate
Research on sodium 3-(oxetan-2-yl)propanoate has highlighted its ability to undergo ring-opening reactions, which are crucial for forming reactive intermediates in various chemical transformations. The strained nature of the oxetane ring makes it particularly susceptible to nucleophilic attack, facilitating further reactions that can lead to diverse products.
Biological Activity of Sodium 3-(oxetan-2-yl)propanoate
Compounds containing oxetane rings, including sodium 3-(oxetan-2-yl)propanoate, have garnered interest in medicinal chemistry due to their potential biological activities. The unique structure of the oxetane ring can influence the physicochemical properties of drug molecules, enhancing their stability and bioavailability. Studies suggest that oxetanes can improve the pharmacokinetic profiles of certain drugs, making them more effective as therapeutic agents.