Spiro[3.5]non-7-en-6-one
Names and Identifiers of Spiro[3.5]non-7-en-6-one
CAS Number |
221342-49-0 |
|---|---|
IUPAC Name |
spiro[3.5]non-6-en-8-one |
InChI |
InChI=1S/C9H12O/c10-8-3-1-4-9(7-8)5-2-6-9/h1,3H,2,4-7H2 |
InChIKey |
WBMWURFLKPUABN-UHFFFAOYSA-N |
Canonical SMILES |
C1CC2(C1)CC=CC(=O)C2 |
Physical and chemical properties of Spiro[3.5]non-7-en-6-one
Exact Mass |
136.08900 |
|---|---|
LogP |
2.07580 |
Molecular Formula |
C9H12O |
Molecular Weight |
136.19100 |
PSA |
17.07000 |
Safety Information of Spiro[3.5]non-7-en-6-one
Applications of Spiro[3.5]non-7-en-6-one
Spiro[3.5]non-7-en-6-one has several applications across different fields:
- Pharmaceuticals: Its derivatives are investigated for potential use as drugs due to their biological activity.
- Chiral Auxiliaries: Used in asymmetric synthesis to produce enantiomerically enriched compounds.
- Material Science: The unique structure may lend itself to applications in developing new materials with specific properties.
Interaction Studies of Spiro[3.5]non-7-en-6-one
Interaction studies involving spiro[3.5]non-7-en-6-one focus on its reactivity with various nucleophiles and electrophiles, providing insights into its behavior in biological systems and synthetic pathways. These studies are essential for understanding how modifications to the compound's structure can enhance or alter its biological activity.
Biological Activity of Spiro[3.5]non-7-en-6-one
Research has indicated that spiro[3.5]non-7-en-6-one and its derivatives exhibit various biological activities. Notably, they have been studied for their potential as antimicrobial agents, with some derivatives showing promising results in inhibiting bacterial growth. Additionally, certain spiro compounds have been explored for their roles as chiral auxiliaries in asymmetric synthesis, enhancing the efficiency of reactions in drug development.
