Spiro[3.5]nonane-7-carboxylic acid
Names and Identifiers of Spiro[3.5]nonane-7-carboxylic acid
CAS Number |
1086399-15-6 |
|---|---|
EC Number |
857-554-9 |
MDL Number |
MFCD11501506 |
IUPAC Name |
spiro[3.5]nonane-7-carboxylic acid |
InChI |
InChI=1S/C10H16O2/c11-9(12)8-2-6-10(7-3-8)4-1-5-10/h8H,1-7H2,(H,11,12) |
InChIKey |
HWXCQNVQAKNSHJ-UHFFFAOYSA-N |
Canonical SMILES |
C1CC2(C1)CCC(CC2)C(=O)O |
UNSPSC Code |
12352100 |
Physical and chemical properties of Spiro[3.5]nonane-7-carboxylic acid
Exact Mass |
168.11500 |
|---|---|
LogP |
2.43150 |
Molecular Formula |
C10H16O2 |
Molecular Weight |
168.23300 |
PSA |
37.30000 |
Safety Information of Spiro[3.5]nonane-7-carboxylic acid
Applications of Spiro[3.5]nonane-7-carboxylic acid
Spiro[3.5]nonane-7-carboxylic acid has several applications:
- Chemical Synthesis: It serves as a building block in the synthesis of more complex spirocyclic compounds.
- Biological Research: Its unique structure makes it valuable for studying enzyme interactions and metabolic pathways.
- Material Science: It is used in developing new materials and as an intermediate in synthesizing specialty chemicals.
Interaction Studies of Spiro[3.5]nonane-7-carboxylic acid
Ongoing studies aim to clarify how spiro[3.5]nonane-7-carboxylic acid interacts with various molecular targets. The compound's ability to fit into specific active sites on enzymes suggests potential roles in modulating biological processes, which could lead to therapeutic applications. Detailed investigations are required to map its interaction profiles and understand its pharmacological potential fully.
Biological Activity of Spiro[3.5]nonane-7-carboxylic acid
The biological activity of spiro[3.5]nonane-7-carboxylic acid is of particular interest due to its potential interactions with enzymes and receptors. Its unique spirocyclic structure allows it to fit into specific binding sites, potentially inhibiting or activating various biological pathways. Research is ongoing to elucidate its exact mechanisms of action and the specific pathways it may influence.
