sodium 2-(5-cyanopyridin-2-yl)acetate
CAS No.:
1803606-70-3
M. Wt:
184.13
M. Fa:
C8H5N2NaO2
InChI Key:
-
Names and Identifiers of sodium 2-(5-cyanopyridin-2-yl)acetate
CAS Number |
1803606-70-3 |
|---|---|
IUPAC Name |
sodium;2-(5-cyanopyridin-2-yl)ethanoate |
Canonical SMILES |
C1=CC(=NC=C1C#N)CC(=O)[O-].[Na+] |
Physical and chemical properties of sodium 2-(5-cyanopyridin-2-yl)acetate
Molecular Formula |
C8H5N2NaO2 |
|---|---|
Molecular Weight |
184.13 |
Applications of sodium 2-(5-cyanopyridin-2-yl)acetate
Sodium 2-(5-cyanopyridin-2-yl)acetate has several applications:
- Organic Synthesis: It serves as an important intermediate in the synthesis of pharmaceuticals and agrochemicals.
- Biological Research: Its derivatives are often used in biological assays due to their potential therapeutic effects.
- Catalysis: This compound may act as a catalyst or catalyst precursor in various organic reactions.
Interaction Studies of sodium 2-(5-cyanopyridin-2-yl)acetate
Interaction studies involving sodium 2-(5-cyanopyridin-2-yl)acetate focus primarily on its binding affinity with various biological molecules. Compounds with similar structures have been shown to interact with DNA and proteins, leading to potential applications in drug design and development. Understanding these interactions is crucial for elucidating the mechanism of action for therapeutic agents derived from this compound.