(1-methyl-1H-indazol-4-yl)boronic acid
CAS No.:
1001907-60-3
M. Wt:
175.98000
M. Fa:
C8H9BN2O2
InChI Key:
MDEHELJMJCXYIU-UHFFFAOYSA-N
Appearance:
Pale-yellow Solid
Names and Identifiers of (1-methyl-1H-indazol-4-yl)boronic acid
CAS Number |
1001907-60-3 |
|---|---|
EC Number |
807-299-4 |
MDL Number |
MFCD09870045 |
IUPAC Name |
(1-methylindazol-4-yl)boronic acid |
InChI |
InChI=1S/C8H9BN2O2/c1-11-8-4-2-3-7(9(12)13)6(8)5-10-11/h2-5,12-13H,1H3 |
InChIKey |
MDEHELJMJCXYIU-UHFFFAOYSA-N |
Canonical SMILES |
B(C1=C2C=NN(C2=CC=C1)C)(O)O |
UNSPSC Code |
12352100 |
Physical and chemical properties of (1-methyl-1H-indazol-4-yl)boronic acid
Boiling Point |
397.5ºC at 760 mmHg |
|---|---|
Density |
1.27 g/cm3 |
Exact Mass |
176.07600 |
Flash Point |
194.2ºC |
Molecular Formula |
C8H9BN2O2 |
Molecular Weight |
175.98000 |
PSA |
58.28000 |
Storage condition |
2~8℃ |
Safety Information of (1-methyl-1H-indazol-4-yl)boronic acid
Applications of (1-methyl-1H-indazol-4-yl)boronic acid
(1-Methyl-1H-indazol-4-yl)boronic acid has several applications:
- Organic Synthesis: It serves as a crucial intermediate in the synthesis of pharmaceuticals and agrochemicals through coupling reactions.
- Material Science: The compound can be used in the development of new materials, particularly those requiring specific electronic or optical properties due to its unique structure.
- Biological Research: Its potential interactions with biological systems make it a candidate for further investigation in drug development and biochemical studies.
Interaction Studies of (1-methyl-1H-indazol-4-yl)boronic acid
Interaction studies involving (1-methyl-1H-indazol-4-yl)boronic acid focus on its binding affinity with various biological targets. These studies typically employ techniques such as:
- Molecular Docking: Computational methods to predict how this compound interacts with proteins or enzymes.
- In vitro Assays: Laboratory experiments assessing the biological effects and mechanisms of action when exposed to cellular systems.
These studies are essential for understanding its potential therapeutic roles and optimizing its chemical properties for specific applications.
Physical sample testing spectrum (NMR) of (1-methyl-1H-indazol-4-yl)boronic acid
