(3-Ethoxy-4-fluorophenyl)methanol
Names and Identifiers of (3-Ethoxy-4-fluorophenyl)methanol
CAS Number |
1000207-64-6 |
|---|---|
MDL Number |
MFCD19440324 |
IUPAC Name |
(3-ethoxy-4-fluorophenyl)methanol |
InChI |
InChI=1S/C9H11FO2/c1-2-12-9-5-7(6-11)3-4-8(9)10/h3-5,11H,2,6H2,1H3 |
InChIKey |
ZIPISVQOZJVRKD-UHFFFAOYSA-N |
Canonical SMILES |
CCOC1=C(C=CC(=C1)CO)F |
UNSPSC Code |
12352100 |
Physical and chemical properties of (3-Ethoxy-4-fluorophenyl)methanol
Boiling Point |
274.3±25.0 °C(Predicted) |
|---|---|
Density |
1.150±0.06 g/cm3(Predicted) |
H Bond Acceptors |
2 |
H Bond Donors |
1 |
LogP |
1.547734674 |
Molecular Formula |
C9H11FO2 |
Molecular Weight |
170.18 |
Safety Information of (3-Ethoxy-4-fluorophenyl)methanol
Applications of (3-Ethoxy-4-fluorophenyl)methanol
(3-Ethoxy-4-fluorophenyl)methanol has several applications across various fields:
- Chemical Research: It serves as a building block for synthesizing more complex organic compounds.
- Pharmaceutical Development: The compound is investigated for its potential therapeutic effects, particularly in anti-inflammatory and anticancer contexts.
- Material Science: Its unique properties may find applications in developing new materials with specific functionalities.
Interaction Studies of (3-Ethoxy-4-fluorophenyl)methanol
Studies on the interactions of (3-Ethoxy-4-fluorophenyl)methanol with biological targets are essential for understanding its potential applications. These interactions may involve binding to specific enzymes or receptors, influencing their activity and leading to various biological effects. Detailed mechanistic studies are required to clarify these interactions further.
Similar CompoundsSeveral compounds share structural similarities with (3-Ethoxy-4-fluorophenyl)methanol, each exhibiting unique characteristics:
| Compound Name | Structure Features | Unique Properties |
|---|---|---|
| 3-Ethoxy-5-fluorophenyl)methanol | Similar ethoxy and fluorine groups | Different positioning of fluorine |
| 3-Ethoxy-4-hydroxybenzaldehyde | Hydroxy instead of methanol | Potentially different reactivity |
| 3-Fluoro-4-methoxyphenylmethanol | Methoxy group instead of ethoxy | Variation in solubility and reactivity |
Biological Activity of (3-Ethoxy-4-fluorophenyl)methanol
Research into the biological activity of (3-Ethoxy-4-fluorophenyl)methanol suggests potential therapeutic applications. Its unique structure may contribute to:
- Anti-inflammatory Properties: Preliminary studies indicate that compounds with similar structures may exhibit anti-inflammatory effects, making this compound a candidate for further investigation.
- Anticancer Activity: Some derivatives of fluorinated phenols have shown promise in anticancer research, suggesting that (3-Ethoxy-4-fluorophenyl)methanol could also possess similar bioactive properties.
Further studies are necessary to elucidate its specific mechanisms of action and therapeutic potential.