(5-Fluorobiphenyl-2-yl)methanamine
Names and Identifiers of (5-Fluorobiphenyl-2-yl)methanamine
CAS Number |
1002557-11-0 |
|---|---|
MDL Number |
MFCD14701931 |
IUPAC Name |
(4-fluoro-2-phenylphenyl)methanamine |
InChI |
InChI=1S/C13H12FN/c14-12-7-6-11(9-15)13(8-12)10-4-2-1-3-5-10/h1-8H,9,15H2 |
InChIKey |
YRGMOGJZQSBAOL-UHFFFAOYSA-N |
Canonical SMILES |
C1=CC=C(C=C1)C2=C(C=CC(=C2)F)CN |
UNSPSC Code |
12352100 |
Physical and chemical properties of (5-Fluorobiphenyl-2-yl)methanamine
Acidity coefficient |
8.92±0.10(Predicted) |
|---|---|
Boiling Point |
339.4±30.0 °C(Predicted) |
Density |
1.124±0.06 g/cm3(Predicted) |
Exact Mass |
201.09500 |
LogP |
3.65170 |
Molecular Formula |
C13H12FN |
Molecular Weight |
201.23900 |
PSA |
26.02000 |
Safety Information of (5-Fluorobiphenyl-2-yl)methanamine
Applications of (5-Fluorobiphenyl-2-yl)methanamine
(5-Fluorobiphenyl-2-yl)methanamine has potential applications in various fields:
- Pharmaceuticals: Its structural characteristics make it a candidate for drug development, particularly in creating compounds that target specific biological pathways.
- Material Science: The compound may serve as a building block in the synthesis of advanced materials, including polymers and ligands for metal catalysts.
Interaction Studies of (5-Fluorobiphenyl-2-yl)methanamine
Interaction studies involving (5-Fluorobiphenyl-2-yl)methanamine focus on its binding affinity to various biological targets. Preliminary studies suggest that it may interact with receptors involved in neurotransmission or cancer cell proliferation pathways. Further research is necessary to elucidate these interactions fully and determine its therapeutic potential.
Biological Activity of (5-Fluorobiphenyl-2-yl)methanamine
Research indicates that (5-Fluorobiphenyl-2-yl)methanamine may exhibit significant biological activity. Compounds with similar structures have been studied for their potential as inhibitors in various biological pathways, including cancer treatment and neuropharmacology. The presence of the fluorine atom is known to enhance metabolic stability and bioactivity, making this compound a candidate for further pharmacological studies.
Physical sample testing spectrum (NMR) of (5-Fluorobiphenyl-2-yl)methanamine
Cas:1765-93-1
Cas:98-80-6