(Pyridin-2-ylsulfanyl)-acetic acid
Names and Identifiers of (Pyridin-2-ylsulfanyl)-acetic acid
CAS Number |
10002-29-6 |
|---|---|
MDL Number |
MFCD00276114 |
IUPAC Name |
2-pyridin-2-ylsulfanylacetic acid |
InChI |
InChI=1S/C7H7NO2S/c9-7(10)5-11-6-3-1-2-4-8-6/h1-4H,5H2,(H,9,10) |
InChIKey |
IGJFLPNTKLFHMW-UHFFFAOYSA-N |
Canonical SMILES |
C1=CC=NC(=C1)SCC(=O)O |
UNSPSC Code |
12352100 |
Physical and chemical properties of (Pyridin-2-ylsulfanyl)-acetic acid
Boiling Point |
349.5ºC at 760 mmHg |
|---|---|
Density |
1.35 g/cm3 |
Exact Mass |
169.02000 |
Flash Point |
165.2ºC |
LogP |
1.25830 |
Melting Point |
136-137℃ |
Molecular Formula |
C7H7NO2S |
Molecular Weight |
169.20100 |
PSA |
75.49000 |
Storage condition |
2-8°C |
Safety Information of (Pyridin-2-ylsulfanyl)-acetic acid
Applications of (Pyridin-2-ylsulfanyl)-acetic acid
(Pyridin-2-ylsulfanyl)-acetic acid has potential applications in various fields:
- Pharmaceuticals: Due to its biological activity, it may serve as a lead compound in drug development for anti-inflammatory drugs.
- Agriculture: Its properties might be utilized in developing agrochemicals that target specific pests or diseases.
- Material Science: The compound could be explored for use in creating novel materials with specific chemical properties.
Interaction Studies of (Pyridin-2-ylsulfanyl)-acetic acid
Interaction studies have shown that (Pyridin-2-ylsulfanyl)-acetic acid can bind to certain enzymes and receptors, influencing their activity. These studies often utilize techniques such as molecular docking and kinetic assays to elucidate binding affinities and mechanisms of action. Understanding these interactions is crucial for developing therapeutic agents based on this compound.
Biological Activity of (Pyridin-2-ylsulfanyl)-acetic acid
Research indicates that (Pyridin-2-ylsulfanyl)-acetic acid exhibits notable biological activities, including anti-inflammatory properties. Its mechanism of action may involve interaction with various molecular targets such as enzymes or receptors, potentially inhibiting their activity or modulating their function. This compound could play a role in signal transduction pathways and metabolic processes, making it of interest in pharmacological studies.
Cas:114086-04-3
Cas:109-09-1
Cas:68-11-1
Cas:2637-34-5
Cas:79-08-3