(S)-4-Amino-4-methylisoxazolidin-3-one
Names and Identifiers of (S)-4-Amino-4-methylisoxazolidin-3-one
CAS Number |
116810-11-8 |
|---|---|
MDL Number |
MFCD19211418 |
IUPAC Name |
(4S)-4-amino-4-methyl-1,2-oxazolidin-3-one |
InChI |
InChI=1S/C4H8N2O2/c1-4(5)2-8-6-3(4)7/h2,5H2,1H3,(H,6,7)/t4-/m0/s1 |
InChIKey |
VJIUJHBBESBVQB-BYPYZUCNSA-N |
Canonical SMILES |
CC1(CONC1=O)N |
Isomeric SMILES |
C[C@@]1(CONC1=O)N |
UNSPSC Code |
12352100 |
Physical and chemical properties of (S)-4-Amino-4-methylisoxazolidin-3-one
H Bond Acceptors |
3 |
|---|---|
H Bond Donors |
2 |
LogP |
-1.98576130938085 |
Molecular Formula |
C4H8N2O2 |
Molecular Weight |
116.12 |
Safety Information of (S)-4-Amino-4-methylisoxazolidin-3-one
Applications of (S)-4-Amino-4-methylisoxazolidin-3-one
(S)-4-Amino-4-methylisoxazolidin-3-one finds various applications in medicinal chemistry:
- Pharmaceutical Intermediates: It serves as an important intermediate in the synthesis of antibiotics and other therapeutic agents.
- Chiral Auxiliaries: The compound can be used as a chiral auxiliary in asymmetric synthesis, aiding in the production of enantiomerically pure compounds .
- Research Tool: Its unique structure makes it valuable in research settings for studying mechanisms of action and developing new drugs.
Interaction Studies of (S)-4-Amino-4-methylisoxazolidin-3-one
Studies have shown that (S)-4-Amino-4-methylisoxazolidin-3-one interacts with specific molecular targets within bacterial cells. Its ability to inhibit protein synthesis highlights its potential as a lead compound for developing new antibiotics. Additionally, research into its interactions with various cellular components may provide insights into optimizing its efficacy and reducing side effects .
Biological Activity of (S)-4-Amino-4-methylisoxazolidin-3-one
(S)-4-Amino-4-methylisoxazolidin-3-one exhibits significant biological activity, particularly as an antibacterial agent. Its mechanism of action involves inhibiting bacterial protein synthesis by binding to the ribosomal subunit, thereby preventing the formation of essential proteins required for bacterial growth . Additionally, this compound has been studied for its antiviral properties and potential use in treating various infections.