[2,2'-Bipyridine]-4,4'-dicarbaldehyde
Names and Identifiers of [2,2'-Bipyridine]-4,4'-dicarbaldehyde
CAS Number |
99970-84-0 |
|---|---|
EC Number |
635-588-3 |
MDL Number |
MFCD00667770 |
IUPAC Name |
2-(4-formylpyridin-2-yl)pyridine-4-carbaldehyde |
InChI |
InChI=1S/C12H8N2O2/c15-7-9-1-3-13-11(5-9)12-6-10(8-16)2-4-14-12/h1-8H |
InChIKey |
UJCACAOPZBJKIW-UHFFFAOYSA-N |
Canonical SMILES |
C1=CN=C(C=C1C=O)C2=NC=CC(=C2)C=O |
UNSPSC Code |
12352100 |
Physical and chemical properties of [2,2'-Bipyridine]-4,4'-dicarbaldehyde
Acidity coefficient |
2.03±0.30(Predicted) |
|---|---|
Boiling Point |
434.4ºC at 760 mmHg |
Density |
1.289g/cm3 |
Exact Mass |
212.05900 |
Flash Point |
217.3ºC |
Index of Refraction |
1.657 |
LogP |
1.76860 |
Melting Point |
188ºC (dec.)(lit.) |
Molecular Formula |
C12H8N2O2 |
Molecular Weight |
212.20400 |
PSA |
59.92000 |
Storage condition |
under inert gas (nitrogen or Argon) at 2-8°C |
Safety Information of [2,2'-Bipyridine]-4,4'-dicarbaldehyde
Interaction Studies of [2,2'-Bipyridine]-4,4'-dicarbaldehyde
Studies have shown that [2,2'-Bipyridine]-4,4'-dicarbaldehyde interacts with biological macromolecules such as proteins and nucleic acids. Its ability to form stable complexes can influence cellular processes and has implications for drug design and development. For instance, it has demonstrated binding affinity to DNA and bovine serum albumin, suggesting its potential role in therapeutic applications.
Biological Activity of [2,2'-Bipyridine]-4,4'-dicarbaldehyde
Research indicates that [2,2'-Bipyridine]-4,4'-dicarbaldehyde exhibits significant biological activities. It can interact with amino acid residues in proteins through covalent bonding, potentially influencing various biochemical pathways. The compound has been studied for its role in DNA binding and antioxidant activity. Additionally, complexes formed with this compound have shown promising cytotoxicity against various cancer cell lines while exhibiting lower toxicity towards normal cells.
Physical sample testing spectrum (NMR) of [2,2'-Bipyridine]-4,4'-dicarbaldehyde
