1,2-Benzoxazol-7-ol
CAS No.:
55559-31-4
M. Wt:
135.12000
M. Fa:
C7H5NO2
InChI Key:
IUWKCOMOHIDVRE-UHFFFAOYSA-N
Names and Identifiers of 1,2-Benzoxazol-7-ol
CAS Number |
55559-31-4 |
|---|---|
EC Number |
839-889-2 |
MDL Number |
MFCD09027559 |
IUPAC Name |
1,2-benzoxazol-7-ol |
InChI |
InChI=1S/C7H5NO2/c9-6-3-1-2-5-4-8-10-7(5)6/h1-4,9H |
InChIKey |
IUWKCOMOHIDVRE-UHFFFAOYSA-N |
Canonical SMILES |
C1=CC2=C(C(=C1)O)ON=C2 |
UNSPSC Code |
12352100 |
Physical and chemical properties of 1,2-Benzoxazol-7-ol
Exact Mass |
135.03200 |
|---|---|
H Bond Acceptors |
2 |
H Bond Donors |
1 |
LogP |
1.53340 |
Molecular Formula |
C7H5NO2 |
Molecular Weight |
135.12000 |
PSA |
46.26000 |
Storage condition |
2-8°C |
Safety Information of 1,2-Benzoxazol-7-ol
Applications of 1,2-Benzoxazol-7-ol
1,2-Benzoxazol-7-ol finds applications in various fields:
- Pharmaceuticals: Its biological activities make it a candidate for drug development against infections and cancer.
- Material Science: Used in creating polymers and other materials due to its unique chemical structure.
- Analytical Chemistry: Employed as a reagent in various analytical techniques due to its ability to form complexes with metal ions.
Interaction Studies of 1,2-Benzoxazol-7-ol
Studies on the interactions of 1,2-benzoxazol-7-ol with biological systems have revealed:
- Binding Affinity: Research indicates that it can bind effectively to certain proteins involved in disease processes, suggesting mechanisms for its biological activity.
- Synergistic Effects: When combined with other compounds, it may enhance therapeutic effects or reduce side effects in drug formulations.
These studies are crucial for understanding its potential as a therapeutic agent and guiding future research directions.
Biological Activity of 1,2-Benzoxazol-7-ol
1,2-Benzoxazol-7-ol exhibits notable biological activities, including:
- Antimicrobial Properties: Some studies suggest that it has inhibitory effects against various bacterial strains.
- Anticancer Activity: Preliminary research indicates potential cytotoxic effects on cancer cell lines, making it a candidate for further pharmacological development.
- Antioxidant Effects: The compound may exhibit antioxidant properties, contributing to cellular protection against oxidative stress.
Physical sample testing spectrum (NMR) of 1,2-Benzoxazol-7-ol
