1,4-Dioxaspiro[4.5]dec-6-ene
CAS No.:
1004-58-6
M. Wt:
140.18000
M. Fa:
C8H12O2
InChI Key:
BUDISQPHJKMXOY-UHFFFAOYSA-N
Names and Identifiers of 1,4-Dioxaspiro[4.5]dec-6-ene
CAS Number |
1004-58-6 |
|---|---|
IUPAC Name |
1,4-dioxaspiro[4.5]dec-6-ene |
InChI |
InChI=1S/C8H12O2/c1-2-4-8(5-3-1)9-6-7-10-8/h2,4H,1,3,5-7H2 |
InChIKey |
BUDISQPHJKMXOY-UHFFFAOYSA-N |
Canonical SMILES |
C1CC=CC2(C1)OCCO2 |
Physical and chemical properties of 1,4-Dioxaspiro[4.5]dec-6-ene
Exact Mass |
140.08400 |
|---|---|
LogP |
1.46960 |
Molecular Formula |
C8H12O2 |
Molecular Weight |
140.18000 |
PSA |
18.46000 |
Safety Information of 1,4-Dioxaspiro[4.5]dec-6-ene
Applications of 1,4-Dioxaspiro[4.5]dec-6-ene
1,4-Dioxaspiro[4.5]dec-6-ene has several applications across different fields:
- Organic Synthesis: It serves as a valuable building block in the synthesis of more complex organic molecules, particularly in pharmaceutical development.
- Material Science: The compound's unique properties make it suitable for creating specialty chemicals and materials with tailored characteristics.
- Biological Research: Its structural features make it an interesting candidate for studying enzyme interactions and binding affinities in biochemical pathways.
Interaction Studies of 1,4-Dioxaspiro[4.5]dec-6-ene
Interaction studies involving 1,4-dioxaspiro[4.5]dec-6-ene focus on understanding how this compound interacts with various biological targets:
- Enzyme Inhibition: Investigations into how the compound may inhibit specific enzymes could reveal potential therapeutic applications.
- Binding Affinities: Studies measuring binding affinities with receptors or proteins can provide insights into its mechanism of action and efficacy as a drug candidate.
These studies are crucial for advancing the understanding of 1,4-dioxaspiro[4.5]dec-6-ene's potential uses in medicine and biotechnology.
Physical sample testing spectrum (NMR) of 1,4-Dioxaspiro[4.5]dec-6-ene
