1-(2-chloro-4-nitrophenyl)pyrrole
Names and Identifiers of 1-(2-chloro-4-nitrophenyl)pyrrole
CAS Number |
106981-58-2 |
|---|---|
IUPAC Name |
1-(2-chloranyl-4-nitro-phenyl)pyrrole |
Canonical SMILES |
C1=CN(C=C1)C2=C(C=C(C=C2)[N+](=O)[O-])Cl |
Physical and chemical properties of 1-(2-chloro-4-nitrophenyl)pyrrole
Molecular Formula |
C10H7ClN2O2 |
|---|---|
Molecular Weight |
222.63 |
Applications of 1-(2-chloro-4-nitrophenyl)pyrrole
This compound finds applications in various fields:
- Medicinal Chemistry: It serves as an intermediate in synthesizing pharmaceuticals, particularly those targeting neurological disorders.
- Research: Used in studies investigating the interactions of pyrrole derivatives with biological systems.
- Industrial
Interaction Studies of 1-(2-chloro-4-nitrophenyl)pyrrole
Studies on similar compounds reveal that 1-(2-chloro-4-nitrophenyl)-1H-pyrrole may interact with various biomolecules. For instance, related compounds have shown interactions with enzymes involved in metabolic pathways, indicating its potential as a lead compound for developing new therapeutic agents.
Biological Activity of 1-(2-chloro-4-nitrophenyl)pyrrole
1-(2-Chloro-4-nitrophenyl)-1H-pyrrole exhibits notable biological activity. Research indicates that compounds with similar structures may possess antiviral properties, particularly against influenza viruses such as H1N1 and H3N2. Additionally, the presence of the nitro group is often associated with interactions with biological targets, including enzymes and receptors, suggesting potential applications in drug development.