1-(4-Bromophenyl)imidazole
Names and Identifiers of 1-(4-Bromophenyl)imidazole
CAS Number |
10040-96-7 |
|---|---|
EC Number |
674-063-3 |
MDL Number |
MFCD00060489 |
IUPAC Name |
1-(4-bromophenyl)imidazole |
InChI |
InChI=1S/C9H7BrN2/c10-8-1-3-9(4-2-8)12-6-5-11-7-12/h1-7H |
InChIKey |
SERULNRLZWOYPK-UHFFFAOYSA-N |
Canonical SMILES |
C1=CC(=CC=C1N2C=CN=C2)Br |
UNSPSC Code |
12352100 |
Physical and chemical properties of 1-(4-Bromophenyl)imidazole
Acidity coefficient |
5.24±0.10(Predicted) |
|---|---|
Boiling Point |
323.4±25.0 °C at 760 mmHg |
Density |
1.5±0.1 g/cm3 |
Exact Mass |
221.979248 |
Flash Point |
149.4±23.2 °C |
Index of Refraction |
1.640 |
LogP |
2.75 |
Melting Point |
118-120ºC |
Molecular Formula |
C9H7BrN2 |
Molecular Weight |
223.069 |
PSA |
17.82000 |
Storage condition |
Keep in dark place,Inert atmosphere,Room temperature |
Vapour Pressure |
0.0±0.7 mmHg at 25°C |
Safety Information of 1-(4-Bromophenyl)imidazole
Applications of 1-(4-Bromophenyl)imidazole
1-(4-Bromophenyl)imidazole finds applications across various fields:
- Pharmaceuticals: Due to its biological activity, it is explored as a lead compound for developing new drugs targeting specific diseases.
- Material Science: Its unique properties make it suitable for use in creating advanced materials with specific electronic or optical characteristics.
- Chemical Synthesis: It serves as an intermediate in synthesizing more complex organic molecules, particularly in the production of other heterocycles.
Interaction Studies of 1-(4-Bromophenyl)imidazole
Research into the interaction of 1-(4-Bromophenyl)imidazole with biological targets has revealed its potential as an enzyme inhibitor. Studies suggest that it may interact with various receptors and enzymes, influencing metabolic pathways. Understanding these interactions is crucial for assessing its therapeutic potential and safety profile in drug development contexts.
Biological Activity of 1-(4-Bromophenyl)imidazole
Studies indicate that 1-(4-Bromophenyl)imidazole exhibits significant biological activity, particularly as an inhibitor of certain cytochrome P450 enzymes, such as CYP1A2. This inhibition suggests potential applications in pharmacology, particularly in drug metabolism and interactions. Additionally, its structural properties may contribute to antimicrobial and antitumor activities, making it a candidate for further investigation in medicinal chemistry.
Physical sample testing spectrum (NMR) of 1-(4-Bromophenyl)imidazole
Cas:106-37-6
Cas:288-32-4
Cas:18156-74-6
Cas:460-00-4