1-(5-Fluoro-2-methylphenyl)pyrrolidine
CAS No.:
1000339-32-1
M. Wt:
179.23400
M. Fa:
C11H14FN
InChI Key:
GOOZUHYJYYEFLB-UHFFFAOYSA-N
Names and Identifiers of 1-(5-Fluoro-2-methylphenyl)pyrrolidine
CAS Number |
1000339-32-1 |
|---|---|
MDL Number |
MFCD09878397 |
IUPAC Name |
1-(5-fluoro-2-methylphenyl)pyrrolidine |
InChI |
InChI=1S/C11H14FN/c1-9-4-5-10(12)8-11(9)13-6-2-3-7-13/h4-5,8H,2-3,6-7H2,1H3 |
InChIKey |
GOOZUHYJYYEFLB-UHFFFAOYSA-N |
Canonical SMILES |
CC1=CC=C(F)C=C1N1CCCC1 |
UNSPSC Code |
12352100 |
Physical and chemical properties of 1-(5-Fluoro-2-methylphenyl)pyrrolidine
Exact Mass |
179.11100 |
|---|---|
H Bond Acceptors |
1 |
H Bond Donors |
0 |
LogP |
2.79930 |
Molecular Formula |
C11H14FN |
Molecular Weight |
179.23400 |
PSA |
3.24000 |
Storage condition |
2-8°C |
Safety Information of 1-(5-Fluoro-2-methylphenyl)pyrrolidine
Applications of 1-(5-Fluoro-2-methylphenyl)pyrrolidine
1-(5-Fluoro-2-methylphenyl)pyrrolidine has potential applications in various fields:
- Pharmaceuticals: Its unique structure may contribute to drug development, particularly in creating novel therapeutic agents targeting specific biological pathways.
- Chemical Research: As a building block in organic synthesis, this compound can serve as an intermediate for synthesizing more complex molecules.
Interaction Studies of 1-(5-Fluoro-2-methylphenyl)pyrrolidine
Interaction studies involving 1-(5-Fluoro-2-methylphenyl)pyrrolidine have focused on its binding affinities and mechanisms of action:
- Receptor Binding: Similar compounds have been studied for their ability to bind to neurotransmitter receptors, suggesting that this compound may also interact with such biological targets.
- Structure-Activity Relationships: Investigations into how structural modifications affect biological activity could provide insights into optimizing this compound for specific applications.
Biological Activity of 1-(5-Fluoro-2-methylphenyl)pyrrolidine
1-(5-Fluoro-2-methylphenyl)pyrrolidine exhibits significant biological activity, primarily due to the influence of the pyrrolidine structure:
- Antimicrobial Properties: Similar pyrrolidine derivatives have shown promise as antimicrobial agents, suggesting potential therapeutic applications.
- Neuroactive Effects: Compounds with similar structures have been investigated for their interactions with neurotransmitter systems, indicating possible roles in modulating neurological functions.
