1-Cyclopropyl-2-nitrobenzene
CAS No.:
10292-65-6
M. Wt:
163.173
M. Fa:
C9H9NO2
InChI Key:
-
Names and Identifiers of 1-Cyclopropyl-2-nitrobenzene
CAS Number |
10292-65-6 |
|---|---|
IUPAC Name |
1-cyclopropyl-2-nitro-benzene |
Canonical SMILES |
C1CC1C2=CC=CC=C2[N+](=O)[O-] |
Physical and chemical properties of 1-Cyclopropyl-2-nitrobenzene
Boiling Point |
250.4±19.0 °C at 760 mmHg |
|---|---|
Density |
1.3±0.1 g/cm3 |
Exact Mass |
163.063324 |
Flash Point |
109.3±14.3 °C |
Index of Refraction |
1.610 |
LogP |
3.00 |
Molecular Formula |
C9H9NO2 |
Molecular Weight |
163.173 |
PSA |
45.82000 |
Vapour Pressure |
0.0±0.5 mmHg at 25°C |
Applications of 1-Cyclopropyl-2-nitrobenzene
1-Cyclopropyl-2-nitrobenzene serves as a key intermediate in organic synthesis, particularly for:
- Pharmaceuticals: It may be utilized in the development of new drugs due to its potential biological activities.
- Agricultural Chemicals: Its derivatives could be explored for use in pesticides or herbicides.
- Material Science: The compound may find applications in creating new materials or polymers with specific properties.
Interaction Studies of 1-Cyclopropyl-2-nitrobenzene
Interaction studies involving 1-cyclopropyl-2-nitrobenzene typically focus on its reactivity with other chemical species. Investigations into its interactions with nucleophiles or electrophiles are essential to understand its behavior in various chemical environments. Additionally, studies examining its biological interactions could provide insights into its pharmacodynamics and toxicology.
Research into similar compounds suggests that understanding these interactions could lead to improved applications in medicinal chemistry and materials science.
Cas:411235-57-9
Cas:577-19-5
Cas:3158-73-4
Cas:57807-29-1