1-Methyl-4-phenoxy-1H-indazol-3-amine
CAS No.:
1000018-07-4
M. Wt:
239.27300
M. Fa:
C14H13N3O
InChI Key:
WRWPMLQRWYBBLY-UHFFFAOYSA-N
Names and Identifiers of 1-Methyl-4-phenoxy-1H-indazol-3-amine
CAS Number |
1000018-07-4 |
|---|---|
IUPAC Name |
1-methyl-4-phenoxyindazol-3-amine |
InChI |
InChI=1S/C14H13N3O/c1-17-11-8-5-9-12(13(11)14(15)16-17)18-10-6-3-2-4-7-10/h2-9H,1H3,(H2,15,16) |
InChIKey |
WRWPMLQRWYBBLY-UHFFFAOYSA-N |
Canonical SMILES |
CN1C2=C(C(=CC=C2)OC3=CC=CC=C3)C(=N1)N |
Physical and chemical properties of 1-Methyl-4-phenoxy-1H-indazol-3-amine
Exact Mass |
239.10600 |
|---|---|
LogP |
3.52900 |
Molecular Formula |
C14H13N3O |
Molecular Weight |
239.27300 |
PSA |
53.07000 |
Applications of 1-Methyl-4-phenoxy-1H-indazol-3-amine
The primary applications of 1-Methyl-4-phenoxy-1H-indazol-3-amine include:
- Pharmaceutical Development: It is being investigated as a potential therapeutic agent for cancer treatment due to its antitumor properties.
- Research Tool: The compound serves as a model for studying indazole derivatives and their biological effects in various biochemical pathways.
Interaction Studies of 1-Methyl-4-phenoxy-1H-indazol-3-amine
Interaction studies have focused on understanding how 1-Methyl-4-phenoxy-1H-indazol-3-amine interacts with biological targets, such as:
- Protein Kinases: Investigations into its binding affinity and inhibition mechanisms against specific kinases have been conducted, providing insights into its potential as an anticancer drug.
Biological Activity of 1-Methyl-4-phenoxy-1H-indazol-3-amine
1-Methyl-4-phenoxy-1H-indazol-3-amine has shown promising biological activities:
- Antitumor Activity: Studies indicate that this compound exhibits significant inhibitory effects against various cancer cell lines, including K562 leukemia cells. The presence of specific substituents on the phenoxy group can influence its potency.
- Enzyme Inhibition: It has been explored as an inhibitor of certain kinases, which are critical in cancer progression and other diseases.