Ethyl 2-(6-oxo-4-(piperazin-1-yl)pyridazin-1(6H)-yl)acetate
Names and Identifiers of 1000018-24-5
CAS Number |
1000018-24-5 |
|---|---|
IUPAC Name |
ethyl 2-(6-oxo-4-piperazin-1-ylpyridazin-1-yl)acetate |
InChI |
InChI=1S/C12H18N4O3/c1-2-19-12(18)9-16-11(17)7-10(8-14-16)15-5-3-13-4-6-15/h7-8,13H,2-6,9H2,1H3 |
InChIKey |
RVWYQADKYFRQJZ-UHFFFAOYSA-N |
Canonical SMILES |
CCOC(=O)CN1C(=O)C=C(C=N1)N2CCNCC2 |
Physical and chemical properties of 1000018-24-5
Acidity coefficient |
8.82±0.10(Predicted) |
|---|---|
Boiling Point |
408.6±55.0 °C(Predicted) |
Density |
1.33±0.1 g/cm3(Predicted) |
Exact Mass |
266.13800 |
Melting Point |
145～150℃ |
Molecular Formula |
C12H18N4O3 |
Molecular Weight |
266.29600 |
PSA |
76.46000 |
Storage condition |
2-8°C |
Applications of 1000018-24-5
Ethyl 2-(6-oxo-4-(piperazin-1-yl)pyridazin-1(6H)-yl)acetate has potential applications in pharmaceuticals, particularly as an anti-cancer agent or as a treatment for neurological disorders due to its structural similarities with known active compounds. Its derivatives may also be explored for their antibacterial and antifungal properties.
Interaction Studies of 1000018-24-5
Studies on similar compounds have indicated that they can interact with various biological targets, including enzymes and receptors involved in cell proliferation and signaling pathways. The piperazine component may enhance binding affinity to certain targets, making it a focus for further pharmacological studies.
Biological Activity of 1000018-24-5
Research has indicated that compounds similar to ethyl 2-(6-oxo-4-(piperazin-1-yl)pyridazin-1(6H)-yl)acetate exhibit significant biological activities, including anti-proliferative effects against various cancer cell lines. The piperazine moiety is often associated with neuropharmacological activities, suggesting potential applications in treating neurological disorders.