Ethyl 1-(N-(tert-butoxycarbonyl)sulfamoyl)piperidine-4-carboxylate
Names and Identifiers of 1000018-25-6
CAS Number |
1000018-25-6 |
|---|---|
IUPAC Name |
ethyl 1-[(2-methylpropan-2-yl)oxycarbonylsulfamoyl]piperidine-4-carboxylate |
InChI |
InChI=1S/C13H24N2O6S/c1-5-20-11(16)10-6-8-15(9-7-10)22(18,19)14-12(17)21-13(2,3)4/h10H,5-9H2,1-4H3,(H,14,17) |
InChIKey |
HWLHFRDIBQJGNI-UHFFFAOYSA-N |
Canonical SMILES |
CCOC(=O)C1CCN(CC1)S(=O)(=O)NC(=O)OC(C)(C)C |
Physical and chemical properties of 1000018-25-6
Exact Mass |
336.13600 |
|---|---|
LogP |
2.44060 |
Melting Point |
79～81℃ |
Molecular Formula |
C13H24N2O6S |
Molecular Weight |
336.40400 |
PSA |
110.39000 |
Storage condition |
2-8°C |
Applications of 1000018-25-6
Ethyl 1-(N-(tert-butoxycarbonyl)sulfamoyl)piperidine-4-carboxylate finds applications primarily in medicinal chemistry and organic synthesis. Its ability to participate in palladium-catalyzed reactions makes it valuable for creating diverse chemical entities that may have therapeutic potential. Additionally, its derivatives may be explored for their enzyme inhibition properties, contributing to drug discovery efforts.
Interaction Studies of 1000018-25-6
Interaction studies involving Ethyl 1-(N-(tert-butoxycarbonyl)sulfamoyl)piperidine-4-carboxylate focus on its biochemical interactions with enzymes and proteins. These studies are crucial for understanding the compound's mechanism of action and potential therapeutic applications.
Research indicates that compounds with similar structures can exhibit varying degrees of biological activity based on their specific functional groups and molecular conformations. Therefore, ongoing studies aim to elucidate these interactions further to optimize the compound's efficacy as a pharmaceutical agent.
Biological Activity of 1000018-25-6
The biological activity of Ethyl 1-(N-(tert-butoxycarbonyl)sulfamoyl)piperidine-4-carboxylate is largely linked to its potential as an enzyme inhibitor and its involvement in biochemical pathways. Research indicates that derivatives of piperidine-4-carboxylate compounds exhibit enzyme inhibition properties, suggesting that this compound may also possess similar activities.
The mechanism of action typically involves interactions with specific enzymes or proteins, where the compound can act as either a substrate or an inhibitor, influencing various biological processes.