1-(2-Methanesulfonyl-6-methoxy-phenyl)-piperazine
Names and Identifiers of 1000018-42-7
CAS Number |
1000018-42-7 |
|---|---|
MDL Number |
MFCD09750908 |
IUPAC Name |
1-(2-methoxy-6-methylsulfonylphenyl)piperazine |
InChI |
InChI=1S/C12H18N2O3S/c1-17-10-4-3-5-11(18(2,15)16)12(10)14-8-6-13-7-9-14/h3-5,13H,6-9H2,1-2H3 |
InChIKey |
IUJWLYYUUWSKMF-UHFFFAOYSA-N |
Canonical SMILES |
COC1=C(C(=CC=C1)S(=O)(=O)C)N2CCNCC2 |
UNSPSC Code |
12352100 |
Physical and chemical properties of 1000018-42-7
Boiling Point |
494.5±45.0 °C at 760 mmHg |
|---|---|
Density |
1.2±0.1 g/cm3 |
Exact Mass |
270.103821 |
Flash Point |
252.9±28.7 °C |
H Bond Acceptors |
5 |
H Bond Donors |
1 |
Index of Refraction |
1.544 |
LogP |
-0.40 |
Molecular Formula |
C12H18N2O3S |
Molecular Weight |
270.348 |
Vapour Pressure |
0.0±1.3 mmHg at 25°C |
Safety Information of 1000018-42-7
Applications of 1000018-42-7
1-(2-Methanesulfonyl-6-methoxy-phenyl)-piperazine has several applications:
- Pharmaceutical Development: It serves as a precursor in synthesizing various pharmaceuticals, particularly those targeting neurological disorders due to its psychoactive potential.
- Material Science: The compound is used in developing new materials with specific chemical properties.
- Biological Research: It is employed in studying protein interactions and enzyme functions within biological systems.
Interaction Studies of 1000018-42-7
Interaction studies involving 1-(2-Methanesulfonyl-6-methoxy-phenyl)-piperazine focus on its binding affinity to various biological targets. These studies help elucidate the compound's mechanism of action and potential therapeutic uses. For instance, investigations into its inhibitory effects on certain enzymes could reveal pathways for drug development aimed at treating conditions like depression or anxiety.
Biological Activity of 1000018-42-7
1-(2-Methanesulfonyl-6-methoxy-phenyl)-piperazine exhibits various biological activities, primarily due to its interaction with biological targets such as enzymes and receptors. The presence of the sulfonyl group enhances its potential to inhibit specific enzymes, which may lead to therapeutic effects. Research indicates that piperazine derivatives often possess psychoactive properties, making them candidates for further studies in pharmacology.
