7-(chloromethyl)-3-methyl-5H-[1,3]thiazolo[3,2-a]pyrimidin-5-one
Names and Identifiers of 100003-81-4
CAS Number |
100003-81-4 |
|---|---|
EC Number |
874-337-4 |
MDL Number |
MFCD06655025 |
IUPAC Name |
7-(chloromethyl)-3-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
InChI |
InChI=1S/C8H7ClN2OS/c1-5-4-13-8-10-6(3-9)2-7(12)11(5)8/h2,4H,3H2,1H3 |
InChIKey |
CTOHNLKENNHCNA-UHFFFAOYSA-N |
Canonical SMILES |
CC1=CSC2=NC(=CC(=O)N12)CCl |
UNSPSC Code |
12352100 |
Physical and chemical properties of 100003-81-4
Exact Mass |
213.99700 |
|---|---|
LogP |
1.80320 |
Molecular Formula |
C8H7ClN2OS |
Molecular Weight |
214.67200 |
PSA |
62.61000 |
Safety Information of 100003-81-4
Applications of 100003-81-4
7-(Chloromethyl)-3-methyl-5H-[1,3]thiazolo[3,2-a]pyrimidin-5-one has potential applications in medicinal chemistry due to its biological activity. It may serve as a lead compound for developing new antiallergic medications or other therapeutic agents targeting mast cell-related disorders. Additionally, its unique structure makes it a candidate for further studies in drug design and development.
Interaction Studies of 100003-81-4
Interaction studies have shown that 7-(chloromethyl)-3-methyl-5H-[1,3]thiazolo[3,2-a]pyrimidin-5-one can modulate biological pathways associated with allergic responses. These studies often involve evaluating its effects on histamine release from mast cells and assessing its binding affinity to specific receptors involved in allergic reactions. Such interactions highlight the compound's potential as a therapeutic agent in allergy management.
Biological Activity of 100003-81-4
Research indicates that 7-(chloromethyl)-3-methyl-5H-[1,3]thiazolo[3,2-a]pyrimidin-5-one exhibits notable biological activities. It has been studied for its potential as an antiallergic agent and may have implications in treating conditions related to mast cell activation. The compound's unique structure allows it to interact with biological targets effectively, potentially influencing histamine release and other pathways involved in allergic responses.
