4-[(2-fluoro-4-nitrophenoxy)methyl]-1-methylpiperidine
Names and Identifiers of 1000052-54-9
CAS Number |
1000052-54-9 |
|---|---|
MDL Number |
MFCD17014124 |
IUPAC Name |
4-[(2-fluoro-4-nitrophenoxy)methyl]-1-methylpiperidine |
InChI |
InChI=1S/C13H17FN2O3/c1-15-6-4-10(5-7-15)9-19-13-3-2-11(16(17)18)8-12(13)14/h2-3,8,10H,4-7,9H2,1H3 |
InChIKey |
BOYOEFJCLPBOGI-UHFFFAOYSA-N |
Canonical SMILES |
CN1CCC(COC2=CC=C([N+](=O)[O-])C=C2F)CC1 |
UNSPSC Code |
12352100 |
Physical and chemical properties of 1000052-54-9
Exact Mass |
268.12200 |
|---|---|
LogP |
2.91560 |
Molecular Formula |
C13H17FN2O3 |
Molecular Weight |
268.28400 |
PSA |
58.29000 |
Safety Information of 1000052-54-9
Applications of 1000052-54-9
4-[(2-Fluoro-4-nitrophenoxy)methyl]-1-methylpiperidine has diverse applications across various fields:
- Chemistry: Serves as a building block in synthesizing more complex molecules.
- Biology: Utilized in studying biological pathways and mechanisms.
- Medicine: Investigated for potential therapeutic applications, especially in drug development.
- Industry: Employed in producing various chemical intermediates and specialty chemicals.
Interaction Studies of 1000052-54-9
Research into the interaction studies of 4-[(2-Fluoro-4-nitrophenoxy)methyl]-1-methylpiperidine reveals its role as a substrate for P-glycoprotein, indicating its potential influence on drug absorption and distribution in biological systems. Its interactions with cytochrome P450 enzymes suggest that it could affect the metabolism of co-administered drugs, necessitating further investigation into its pharmacokinetic properties.
Biological Activity of 1000052-54-9
The biological activity of 4-[(2-Fluoro-4-nitrophenoxy)methyl]-1-methylpiperidine is primarily associated with its potential interactions with specific molecular targets, such as enzymes and receptors. These interactions can modulate biological pathways, which makes this compound a candidate for various therapeutic applications. Its ability to act as an inhibitor for certain cytochrome P450 enzymes, such as CYP1A2 and CYP3A4, indicates its relevance in pharmacology, particularly in drug metabolism studies.
