3-Fluoro-4-[(1-methylpiperidin-4-yl)methoxy]aniline
Names and Identifiers of 1000053-56-4
CAS Number |
1000053-56-4 |
|---|---|
MDL Number |
MFCD17014177 |
IUPAC Name |
3-fluoro-4-[(1-methylpiperidin-4-yl)methoxy]aniline |
InChI |
InChI=1S/C13H19FN2O/c1-16-6-4-10(5-7-16)9-17-13-3-2-11(15)8-12(13)14/h2-3,8,10H,4-7,9,15H2,1H3 |
InChIKey |
XWUDBNUMHWTNPW-UHFFFAOYSA-N |
Canonical SMILES |
CN1CCC(CC1)COC2=C(C=C(C=C2)N)F |
UNSPSC Code |
12352100 |
Physical and chemical properties of 1000053-56-4
Exact Mass |
238.14800 |
|---|---|
LogP |
2.64760 |
Molecular Formula |
C13H19FN2O |
Molecular Weight |
238.30100 |
PSA |
38.49000 |
Safety Information of 1000053-56-4
Applications of 1000053-56-4
3-Fluoro-4-[(1-methylpiperidin-4-yl)methoxy]aniline has several applications across various fields:
- Medicinal Chemistry: It serves as a building block in the synthesis of pharmaceutical compounds, particularly those targeting neurological disorders.
- Material Science: The compound is utilized in developing novel materials with specific electronic or optical properties.
- Biological Studies: It functions as a probe in biochemical assays for studying enzyme interactions and receptor binding.
- Industrial
Interaction Studies of 1000053-56-4
Interaction studies focus on the binding affinity of 3-Fluoro-4-[(1-methylpiperidin-4-yl)methoxy]aniline towards specific biological targets. These studies are essential for understanding its therapeutic potential and mechanisms of action. The ability of this compound to mimic natural ligands facilitates effective interactions with enzymes and receptors, which is crucial for its applications in drug development.
Similar Compounds: ComparisonSeveral compounds share structural similarities with 3-Fluoro-4-[(1-methylpiperidin-4-yl)methoxy]aniline. Here are notable examples:
| Compound Name | Molecular Formula | Key Characteristics |
|---|---|---|
| 3-Fluoroaniline | C7H6FN | Base structure; lacks piperidine moiety |
| 2-(4-Methylpiperidin-1-yl)aniline | C12H18N2 | Lacks fluorine; primarily used in similar applications |
| 5-Fluoro-2-[(1-methylpiperidin-4-yl)methoxy]aniline | C13H19FN2O | Different fluorine position; similar piperidine structure |
| 4-(Cyclobutylmethoxy)-3,5-difluoroaniline | C13H16F2N2O | Contains multiple fluorines; different biological properties |
Biological Activity of 1000053-56-4
Research indicates that 3-Fluoro-4-[(1-methylpiperidin-4-yl)methoxy]aniline exhibits significant biological activity, particularly as an enzyme inhibitor and receptor modulator. The structural similarities to various bioactive molecules allow it to effectively mimic natural ligands, enhancing its binding affinity to specific biological targets. This property is crucial for its potential therapeutic applications, particularly in treating neurological disorders.
