3-(2-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole
CAS No.:
1000339-25-2
M. Wt:
319.12900
M. Fa:
C14H8BrFN2O
InChI Key:
-
Names and Identifiers of 1000339-25-2
CAS Number |
1000339-25-2 |
|---|---|
IUPAC Name |
3-(2-bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole |
Canonical SMILES |
C1=CC=C(C(=C1)C2=NC(=NO2)C3=CC=CC=C3Br)F |
Physical and chemical properties of 1000339-25-2
Exact Mass |
317.98000 |
|---|---|
LogP |
4.30520 |
Molecular Formula |
C14H8BrFN2O |
Molecular Weight |
319.12900 |
PSA |
38.92000 |
Applications of 1000339-25-2
The applications of 3-(2-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole extend across various fields:
- Pharmaceutical Development: The compound's biological activity makes it a candidate for drug development targeting specific diseases.
- Material Science: Its unique chemical properties are explored in the development of advanced materials, including polymers and coatings.
- Agricultural Chemistry: Potential applications in agrochemicals are also being investigated due to its bioactive properties.
Interaction Studies of 1000339-25-2
Studies on the interactions of 3-(2-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole with biological targets reveal its potential as a lead compound for further modifications. Interaction studies often focus on enzyme inhibition and receptor binding assays to evaluate its pharmacological profile. For instance, its interaction with certain enzymes has shown promise in inhibiting cancer cell proliferation.
Biological Activity of 1000339-25-2
Research indicates that compounds containing the oxadiazole moiety exhibit diverse biological activities, including:
- Antimicrobial Properties: Some derivatives have shown effectiveness against various bacterial strains.
- Anticancer Activity: Studies have explored the potential of oxadiazole derivatives in targeting cancer cells, with some compounds demonstrating significant cytotoxic effects against specific cancer cell lines.
- Antiviral and Antioxidant Effects: Certain oxadiazole compounds have been investigated for their ability to inhibit viral replication and reduce oxidative stress.