2-(1-(4-Bromophenyl)-1H-1,2,3-triazol-4-yl)propan-2-ol
Names and Identifiers of 1000339-34-3
CAS Number |
1000339-34-3 |
|---|---|
MDL Number |
MFCD09878410 |
IUPAC Name |
2-[1-(4-bromophenyl)triazol-4-yl]propan-2-ol |
InChI |
InChI=1S/C11H12BrN3O/c1-11(2,16)10-7-15(14-13-10)9-5-3-8(12)4-6-9/h3-7,16H,1-2H3 |
InChIKey |
RSIHPLASTHLNBG-UHFFFAOYSA-N |
Canonical SMILES |
CC(C)(O)C1=CN(C2=CC=C(Br)C=C2)N=N1 |
UNSPSC Code |
12352100 |
Physical and chemical properties of 1000339-34-3
Exact Mass |
281.01600 |
|---|---|
LogP |
2.25720 |
Molecular Formula |
C11H12BrN3O |
Molecular Weight |
282.13600 |
PSA |
50.94000 |
Storage condition |
2-8°C |
Safety Information of 1000339-34-3
Applications of 1000339-34-3
The applications of 2-(1-(4-Bromophenyl)-1H-1,2,3-triazol-4-yl)propan-2-ol extend into various fields:
- Medicinal Chemistry: As a potential antifungal agent, it can be developed into pharmaceuticals targeting fungal infections.
- Material Science: The compound may serve as a precursor for creating functional materials due to its unique chemical properties.
- Biochemical Research: It can be utilized in studies investigating enzyme inhibition and other biological interactions.
Interaction Studies of 1000339-34-3
Interaction studies have shown that triazole derivatives can bind to various biological targets. For instance, research indicates that 2-(1-(4-Bromophenyl)-1H-1,2,3-triazol-4-yl)propan-2-ol may interact with cytochrome P450 enzymes involved in drug metabolism . These interactions are crucial for understanding the pharmacokinetics and potential drug-drug interactions when used therapeutically.
Biological Activity of 1000339-34-3
Compounds containing triazole rings are known for their diverse biological activities, including antifungal, antibacterial, and anticancer properties. Specifically, 2-(1-(4-Bromophenyl)-1H-1,2,3-triazol-4-yl)propan-2-ol has been studied for its potential antifungal activity against various strains of Candida, showcasing its role in medicinal chemistry . Furthermore, triazoles are recognized for their ability to inhibit enzymes involved in fungal cell wall synthesis, contributing to their effectiveness as antifungal agents.
Cas:106-40-1
Cas:115-19-5