1-methoxy-3-methyl-5-(trifluoromethoxy)benzene
CAS No.:
1000339-56-9
M. Wt:
206.16200
M. Fa:
C9H9F3O2
InChI Key:
-
Names and Identifiers of 1000339-56-9
CAS Number |
1000339-56-9 |
|---|---|
IUPAC Name |
1-methoxy-3-methyl-5-(trifluoromethyloxy)benzene |
Canonical SMILES |
CC1=CC(=CC(=C1)OC(F)(F)F)OC |
Physical and chemical properties of 1000339-56-9
Exact Mass |
206.05500 |
|---|---|
LogP |
2.90220 |
Molecular Formula |
C9H9F3O2 |
Molecular Weight |
206.16200 |
PSA |
18.46000 |
Applications of 1000339-56-9
1-Methoxy-3-methyl-5-(trifluoromethoxy)benzene finds applications in various fields:
- Pharmaceuticals: Its unique electronic properties make it a candidate for drug development, particularly in creating compounds with improved pharmacokinetic profiles.
- Agricultural Chemicals: Similar compounds are often investigated for use as herbicides or pesticides due to their biological activity.
- Material Science: The compound may be utilized in the synthesis of advanced materials where fluorinated functionalities enhance thermal and chemical stability.
Interaction Studies of 1000339-56-9
Interaction studies involving 1-Methoxy-3-methyl-5-(trifluoromethoxy)benzene would typically focus on its binding affinities with biological macromolecules such as proteins or nucleic acids. The trifluoromethoxy group could facilitate hydrogen bonding and other non-covalent interactions, potentially influencing enzyme activity or receptor binding.