1-[(4-Fluoro-2-methylsulfonyl)phenyl]-4-methylpiperazine
Names and Identifiers of 1000339-70-7
CAS Number |
1000339-70-7 |
|---|---|
MDL Number |
MFCD09264547 |
IUPAC Name |
1-(4-fluoro-2-methylsulfonylphenyl)-4-methylpiperazine |
InChI |
InChI=1S/C12H17FN2O2S/c1-14-5-7-15(8-6-14)11-4-3-10(13)9-12(11)18(2,16)17/h3-4,9H,5-8H2,1-2H3 |
InChIKey |
QURSCNLXCVCJTM-UHFFFAOYSA-N |
Canonical SMILES |
CN1CCN(C2=CC=C(F)C=C2S(C)(=O)=O)CC1 |
UNSPSC Code |
12352100 |
Physical and chemical properties of 1000339-70-7
Boiling Point |
441.0±45.0 °C at 760 mmHg |
|---|---|
Density |
1.2±0.1 g/cm3 |
Exact Mass |
272.099487 |
Flash Point |
220.5±28.7 °C |
Index of Refraction |
1.545 |
LogP |
0.54 |
Melting Point |
97~99℃ |
Molecular Formula |
C12H17FN2O2S |
Molecular Weight |
272.339 |
Vapour Pressure |
0.0±1.1 mmHg at 25°C |
Safety Information of 1000339-70-7
Applications of 1000339-70-7
1-[(4-Fluoro-2-methylsulfonyl)phenyl]-4-methylpiperazine has potential applications in various fields:
- Pharmaceutical Development: Its structural features make it a candidate for developing new therapeutic agents targeting neurological disorders.
- Chemical Research: It serves as a building block in organic synthesis for creating more complex molecules.
- Material Science: Investigations into its properties may reveal applications in polymer chemistry or as a precursor in advanced materials.
Interaction Studies of 1000339-70-7
Studies on the interactions of 1-[(4-Fluoro-2-methylsulfonyl)phenyl]-4-methylpiperazine with biological targets are crucial for understanding its pharmacodynamics. Research indicates that this compound may interact with serotonin receptors and dopamine receptors, which are pivotal in mood regulation and psychotropic effects. Further interaction studies using advanced techniques like molecular docking simulations could elucidate binding affinities and mechanisms.
Biological Activity of 1000339-70-7
This compound exhibits significant biological activity, particularly in pharmacological contexts. Piperazine derivatives are often studied for their effects on central nervous system disorders, anti-inflammatory properties, and potential as antipsychotic agents. Preliminary studies suggest that 1-[(4-Fluoro-2-methylsulfonyl)phenyl]-4-methylpiperazine may interact with various neurotransmitter receptors, although specific mechanisms require further investigation.
