7-Bromothieno[3,2-d]pyrimidin-4-amine
Names and Identifiers of 1000340-07-7
CAS Number |
1000340-07-7 |
|---|---|
MDL Number |
MFCD09910415 |
IUPAC Name |
3-(cyanomethylamino)-2-methylbenzoic acid |
InChI |
InChI=1S/C10H10N2O2/c1-7-8(10(13)14)3-2-4-9(7)12-6-5-11/h2-4,12H,6H2,1H3,(H,13,14) |
InChIKey |
JKWRDAHAMJNQAC-UHFFFAOYSA-N |
Canonical SMILES |
CC1=C(NCC#N)C=CC=C1C(=O)O |
UNSPSC Code |
12352100 |
Physical and chemical properties of 1000340-07-7
Molecular Formula |
C10H10N2O2 |
|---|---|
Molecular Weight |
190.2 |
Safety Information of 1000340-07-7
Applications of 1000340-07-7
3-(Cyanomethylamino)-2-methylbenzoic acid has several applications across different fields:
- Chemistry: It serves as an intermediate in the synthesis of more complex organic molecules.
- Biology: Investigated for its potential as a biochemical probe or inhibitor in enzymatic studies.
- Medicine: Explored for its therapeutic properties, particularly in anti-inflammatory and anticancer research.
- Industry: Utilized in producing specialty chemicals and materials with specific properties.
Interaction Studies of 1000340-07-7
The mechanism of action of 3-(Cyanomethylamino)-2-methylbenzoic acid involves interactions with specific molecular targets. The cyanomethylamino group can form hydrogen bonds or electrostatic interactions with active sites on proteins or enzymes, influencing their activity. Understanding these interactions is crucial for developing potential therapeutic applications.
Biological Activity of 1000340-07-7
Research indicates that 3-(Cyanomethylamino)-2-methylbenzoic acid exhibits potential biological activities, making it a candidate for further investigation in medicinal chemistry. Its cyanomethylamino group may interact with specific biological targets, such as enzymes or receptors, potentially modulating their activity. This modulation could lead to various therapeutic effects, including anti-inflammatory and anticancer properties.
