![structure of 5-chloro-6-methyl-3-nitro-1H-pyrrolo[2,3-b]pyridine](https://molwiki.oss-cn-hongkong.aliyuncs.com/structure/15/1000340-15-7.svg)
5-chloro-6-methyl-3-nitro-1H-pyrrolo[2,3-b]pyridine
Names and Identifiers of 1000340-15-7
CAS Number |
1000340-15-7 |
|---|---|
IUPAC Name |
5-chloranyl-6-methyl-3-nitro-1H-pyrrolo[2,3-b]pyridine |
Canonical SMILES |
CC1=C(C=C2C(=CNC2=N1)[N+](=O)[O-])Cl |
Physical and chemical properties of 1000340-15-7
Density |
1.6±0.1 g/cm3 |
|---|---|
Exact Mass |
211.014847 |
Index of Refraction |
1.711 |
LogP |
3.15 |
Molecular Formula |
C8H6ClN3O2 |
Molecular Weight |
211.605 |
PSA |
74.50000 |
Interaction Studies of 1000340-15-7
Studies on interaction profiles indicate that 5-Chloro-6-methyl-3-nitro-1H-pyrrolo[2,3-b]pyridine interacts with various biological targets. These include:
- Enzymatic Inhibition: It may inhibit enzymes critical for cancer cell proliferation.
- Binding Affinity: Its affinity for certain receptors could be explored for therapeutic purposes.
When compared to other nitrogen-containing heterocycles, 5-Chloro-6-methyl-3-nitro-1H-pyrrolo[2,3-b]pyridine stands out due to its specific substitution pattern. Here are some similar compounds:
| Compound Name | Molecular Formula | Unique Features |
|---|---|---|
| 5-Chloro-1H-pyrrolo[2,3-b]pyridine | C7H5ClN2 | Lacks nitro group; different biological activity |
| 6-Methyl-5-nitro-1H-pyrrolo[2,3-b]pyridine | C8H7N3O2 | Different substitution pattern; more reactive |
| 7-Azaindole | C7H6N2 | Lacks chlorine; different electronic properties |
Biological Activity of 1000340-15-7
Research indicates that 5-Chloro-6-methyl-3-nitro-1H-pyrrolo[2,3-b]pyridine exhibits significant biological activities. It has been studied for its potential as an anti-cancer agent due to its ability to inhibit specific enzymes involved in tumor growth. Additionally, its structural characteristics suggest possible antimicrobial properties, although further studies are necessary to confirm these effects.