![structure of 6-methyl-3-nitro-1H-pyrrolo[2,3-b]pyridin-5-amine](https://molwiki.oss-cn-hongkong.aliyuncs.com/structure/23/1000340-23-7.svg)
6-methyl-3-nitro-1H-pyrrolo[2,3-b]pyridin-5-amine
Names and Identifiers of 1000340-23-7
CAS Number |
1000340-23-7 |
|---|---|
IUPAC Name |
6-methyl-3-nitro-1H-pyrrolo[2,3-b]pyridin-5-amine |
InChI |
InChI=1S/C8H8N4O2/c1-4-6(9)2-5-7(12(13)14)3-10-8(5)11-4/h2-3H,9H2,1H3,(H,10,11) |
InChIKey |
XLVOZMGRKACBNZ-UHFFFAOYSA-N |
Canonical SMILES |
CC1=C(C=C2C(=CNC2=N1)[N+](=O)[O-])N |
Physical and chemical properties of 1000340-23-7
Density |
1.5±0.1 g/cm3 |
|---|---|
Exact Mass |
192.064728 |
Index of Refraction |
1.772 |
LogP |
1.30 |
Molecular Formula |
C8H8N4O2 |
Molecular Weight |
192.175 |
PSA |
100.52000 |
Applications of 1000340-23-7
The applications of 6-methyl-3-nitro-1H-pyrrolo[2,3-b]pyridin-5-amine are primarily in pharmaceutical research. Its potential as an FGFR inhibitor positions it as a candidate for cancer therapy. Moreover, its unique structure may allow for further derivatization leading to new compounds with enhanced biological activity or selectivity against specific targets in cellular pathways.
Interaction Studies of 1000340-23-7
Interaction studies involving 6-methyl-3-nitro-1H-pyrrolo[2,3-b]pyridin-5-amine often focus on its binding affinity to various biological receptors and enzymes. These studies utilize techniques such as:
- Molecular Docking: To predict how the compound interacts with target proteins.
- In Vitro Assays: To evaluate its efficacy against specific cancer cell lines or microbial strains.
Such studies are crucial for understanding the compound's mechanism of action and potential therapeutic benefits.
Similar Compounds: Comparison with Other CompoundsSeveral compounds share structural similarities with 6-methyl-3-nitro-1H-pyrrolo[2,3-b]pyridin-5-amine. Below is a comparison highlighting their uniqueness:
| Compound Name | Structural Features | Biological Activity |
|---|---|---|
| 5-amino-1H-pyrrolo[2,3-b]pyridine | Amino group at position 5 | Potential FGFR inhibitor |
| 7-methyl-1H-pyrrolo[2,3-b]pyridine | Methyl substitution at position 7 | Anticancer properties |
| 1H-pyrazolo[4,5-b]pyridine derivatives | Pyrazole ring fused with pyridine | Kinase inhibition |
Biological Activity of 1000340-23-7
6-methyl-3-nitro-1H-pyrrolo[2,3-b]pyridin-5-amine exhibits significant biological activities. Research indicates that derivatives of pyrrolo[2,3-b]pyridines have been identified as potent inhibitors of fibroblast growth factor receptors (FGFRs), which are implicated in various cancers. The compound's ability to modulate these pathways suggests potential therapeutic applications in oncology. Additionally, it may exhibit antimicrobial properties and influence cellular signaling pathways due to its unique structural characteristics.