3-iodo-1H-pyrrolo[3,2-c]pyridine-4-carboxylic acid
Names and Identifiers of 1000341-28-5
CAS Number |
1000341-28-5 |
|---|---|
IUPAC Name |
3-iodanyl-1H-pyrrolo[3,2-c]pyridine-4-carboxylic acid |
Canonical SMILES |
C1=CN=C(C2=C1NC=C2I)C(=O)O |
Physical and chemical properties of 1000341-28-5
Boiling Point |
536.3±45.0 °C at 760 mmHg |
|---|---|
Density |
2.2±0.1 g/cm3 |
Exact Mass |
287.939575 |
Flash Point |
278.2±28.7 °C |
Index of Refraction |
1.820 |
LogP |
0.86 |
Molecular Formula |
C8H5IN2O2 |
Molecular Weight |
288.042 |
PSA |
65.98000 |
Vapour Pressure |
0.0±1.5 mmHg at 25°C |
Applications of 1000341-28-5
The unique structure and reactivity of 3-iodo-1H-pyrrolo[3,2-c]pyridine-4-carboxylic acid make it suitable for various applications:
- Pharmaceutical Development: It serves as a scaffold for developing new therapeutic agents due to its biological activity.
- Chemical Research: Utilized in synthetic organic chemistry for creating complex molecules through various reaction pathways.
- Material Science: Potential applications in developing novel materials or coatings due to its unique chemical properties.
Interaction Studies of 1000341-28-5
Studies examining the interactions of 3-iodo-1H-pyrrolo[3,2-c]pyridine-4-carboxylic acid with biological targets have shown promising results. Its ability to bind with specific proteins involved in cancer pathways suggests a mechanism of action that warrants further investigation. Additionally, interaction with enzymes may reveal insights into its metabolic pathways and potential side effects when used therapeutically.
Biological Activity of 1000341-28-5
Research indicates that 3-iodo-1H-pyrrolo[3,2-c]pyridine-4-carboxylic acid exhibits significant biological activity. It has been studied for its potential as an anti-cancer agent, showing efficacy in inhibiting tumor growth in various cancer cell lines. Additionally, it may possess antimicrobial properties, although further studies are needed to fully understand its pharmacological profile.