3-Bromo-1H-pyrrolo[3,2-c]pyridine-4-carboxylic acid
Names and Identifiers of 1000341-43-4
CAS Number |
1000341-43-4 |
|---|---|
EC Number |
971-984-5 |
IUPAC Name |
3-bromo-1H-pyrrolo[3,2-c]pyridine-4-carboxylic acid |
InChI |
InChI=1S/C8H5BrN2O2/c9-4-3-11-5-1-2-10-7(6(4)5)8(12)13/h1-3,11H,(H,12,13) |
InChIKey |
BSDGCRRFFXKHMG-UHFFFAOYSA-N |
Canonical SMILES |
C1=CN=C(C2=C1NC=C2Br)C(=O)O |
Physical and chemical properties of 1000341-43-4
Boiling Point |
518.6±45.0 °C at 760 mmHg |
|---|---|
Density |
1.9±0.1 g/cm3 |
Exact Mass |
239.953430 |
Flash Point |
267.4±28.7 °C |
Index of Refraction |
1.766 |
LogP |
0.60 |
Molecular Formula |
C8H5BrN2O2 |
Molecular Weight |
241.042 |
PSA |
65.98000 |
Vapour Pressure |
0.0±1.4 mmHg at 25°C |
Safety Information of 1000341-43-4
Applications of 1000341-43-4
3-Bromo-1H-pyrrolo[3,2-c]pyridine-4-carboxylic acid has several applications in scientific research:
- Medicinal Chemistry: It is utilized as an intermediate for developing potential therapeutic agents.
- Organic Synthesis: The compound serves as a versatile building block for synthesizing more complex heterocyclic compounds.
- Biological Studies: It aids in understanding biological pathways and mechanisms related to signal transduction and cellular communication.
Interaction Studies of 1000341-43-4
Studies on the interactions of 3-bromo-1H-pyrrolo[3,2-c]pyridine-4-carboxylic acid with biological targets have highlighted its role in inhibiting specific enzymes and receptors. For example, its derivatives have been shown to effectively inhibit fibroblast growth factor receptors, which are implicated in various cancers. This inhibition mechanism underscores its potential as a therapeutic agent in oncology.
Biological Activity of 1000341-43-4
This compound has shown potential biological activity, particularly in medicinal chemistry. It serves as a building block for synthesizing therapeutic agents targeting various proteins involved in cancer and inflammatory diseases. Notably, derivatives of 3-bromo-1H-pyrrolo[3,2-c]pyridine-4-carboxylic acid have been identified as inhibitors of fibroblast growth factor receptors (FGFRs), which are crucial for cell proliferation and survival. Inhibition of these receptors can lead to reduced tumor growth and metastasis.
