methyl 7-amino-5-methoxy-1H-indole-2-carboxylate
Names and Identifiers of 1000341-45-6
CAS Number |
1000341-45-6 |
|---|---|
IUPAC Name |
methyl 7-azanyl-5-methoxy-1H-indole-2-carboxylate |
Canonical SMILES |
COC1=CC(=C2C(=C1)C=C(N2)C(=O)OC)N |
Physical and chemical properties of 1000341-45-6
Boiling Point |
453.0±40.0 °C at 760 mmHg |
|---|---|
Density |
1.3±0.1 g/cm3 |
Exact Mass |
220.084793 |
Flash Point |
227.7±27.3 °C |
Index of Refraction |
1.659 |
LogP |
1.09 |
Molecular Formula |
C11H12N2O3 |
Molecular Weight |
220.225 |
PSA |
77.34000 |
Vapour Pressure |
0.0±1.1 mmHg at 25°C |
Applications of 1000341-45-6
Methyl 7-amino-5-methoxy-1H-indole-2-carboxylate has potential applications in various fields:
- Pharmaceutical Development: Its role as a melatonin receptor agonist opens avenues for developing treatments for sleep disorders.
- Biochemical Research: It can serve as a precursor or building block for synthesizing more complex molecules used in biological studies.
- Agricultural Chemistry: Compounds with similar structures may exhibit properties beneficial for plant growth regulation or pest control.
Interaction Studies of 1000341-45-6
Research into the interactions of methyl 7-amino-5-methoxy-1H-indole-2-carboxylate with biological targets is crucial for understanding its pharmacodynamics. Studies have indicated that it may interact with melatonin receptors (MT1 and MT2), influencing circadian rhythms and sleep patterns. Additionally, its structural features suggest potential interactions with other receptors involved in inflammation and cancer pathways.
Biological Activity of 1000341-45-6
Methyl 7-amino-5-methoxy-1H-indole-2-carboxylate exhibits significant biological activities that make it a compound of interest in pharmacological research. It has been noted for its potential as a melatonin receptor agonist, which could lead to applications in sleep disorders and other melatonin-related conditions. Additionally, compounds with similar structures have shown anti-inflammatory, antioxidant, and antitumor properties.