6-(Methylthio)-1H-pyrazolo[3,4-D]pyrimidin-3(2H)-one
Names and Identifiers of 100047-42-5
CAS Number |
100047-42-5 |
|---|---|
MDL Number |
MFCD09754087 |
IUPAC Name |
6-methylsulfanyl-1,2-dihydropyrazolo[3,4-d]pyrimidin-3-one |
InChI |
InChI=1S/C6H6N4OS/c1-12-6-7-2-3-4(8-6)9-10-5(3)11/h2H,1H3,(H2,7,8,9,10,11) |
InChIKey |
AERITGXHLJUXPT-UHFFFAOYSA-N |
Canonical SMILES |
CSC1=NC=C2C(=N1)NNC2=O |
UNSPSC Code |
12352100 |
Physical and chemical properties of 100047-42-5
Density |
1.78±0.1 g/cm3(Predicted) |
|---|---|
Exact Mass |
182.02600 |
H Bond Acceptors |
4 |
H Bond Donors |
2 |
LogP |
0.78040 |
Molecular Formula |
C6H6N4OS |
Molecular Weight |
182.20300 |
PSA |
99.99000 |
Storage condition |
RT |
Safety Information of 100047-42-5
Applications of 100047-42-5
The compound has diverse applications in medicinal chemistry, particularly in:
- Drug Development: Its ability to inhibit kinases makes it a candidate for developing anticancer therapies.
- Biochemical Research: It serves as a tool for studying kinase-related signaling pathways and cellular processes .
Interaction Studies of 100047-42-5
Interaction studies have demonstrated that 6-(Methylthio)-1H-pyrazolo[3,4-D]pyrimidin-3(2H)-one can effectively inhibit certain kinases involved in critical signaling pathways. These interactions can disrupt pathways such as RAS–MEK–ERK and PI3K–Akt, which are essential for tumor growth and survival .
Biological Activity of 100047-42-5
6-(Methylthio)-1H-pyrazolo[3,4-D]pyrimidin-3(2H)-one exhibits significant biological activities, particularly as a potential kinase inhibitor. It has been shown to interact with various protein kinases, affecting signaling pathways crucial for cell proliferation and survival. Its unique structure allows it to act as a serotonin receptor antagonist, which is beneficial in developing treatments for various conditions .
Physical sample testing spectrum (NMR) of 100047-42-5
