1-(Tetrahydro-2H-pyran-2-yl)-1H-indazole-5-carboxylic acid
CAS No.:
1000576-28-2
M. Wt:
246.26200
M. Fa:
C13H14N2O3
InChI Key:
MNUJUQSXOGLRNS-UHFFFAOYSA-N
Appearance:
Pale-yellow Solid
Names and Identifiers of 1000576-28-2
CAS Number |
1000576-28-2 |
|---|---|
IUPAC Name |
1-(oxan-2-yl)indazole-5-carboxylic acid |
InChI |
InChI=1S/C13H14N2O3/c16-13(17)9-4-5-11-10(7-9)8-14-15(11)12-3-1-2-6-18-12/h4-5,7-8,12H,1-3,6H2,(H,16,17) |
InChIKey |
MNUJUQSXOGLRNS-UHFFFAOYSA-N |
Canonical SMILES |
C1CCOC(C1)N2C3=C(C=C(C=C3)C(=O)O)C=N2 |
Physical and chemical properties of 1000576-28-2
Acidity coefficient |
4.00±0.30(Predicted) |
|---|---|
Boiling Point |
480.1±35.0 °C(Predicted) |
Density |
1.42±0.1 g/cm3(Predicted) |
Exact Mass |
246.10000 |
LogP |
2.43360 |
Molecular Formula |
C13H14N2O3 |
Molecular Weight |
246.26200 |
PSA |
64.35000 |
Storage condition |
2-8°C |
Applications of 1000576-28-2
The unique structure of 1-(tetrahydro-2H-pyran-2-yl)-1H-indazole-5-carboxylic acid makes it a candidate for various applications in medicinal chemistry and drug development. Its potential use includes:
- Pharmaceutical Development: As a lead compound for designing new drugs targeting specific diseases.
- Chemical Probes: In biochemical research to study biological pathways involving indazole derivatives.
Interaction Studies of 1000576-28-2
Studies on the interactions of 1-(tetrahydro-2H-pyran-2-yl)-1H-indazole-5-carboxylic acid with biological macromolecules are crucial for understanding its mechanism of action. Preliminary investigations may involve:
- Binding Affinity Assessments: Evaluating how well the compound binds to target proteins or enzymes.
- Cellular Assays: Testing its effects on cell viability and proliferation in various cancer cell lines.
Physical sample testing spectrum (NMR) of 1000576-28-2