Methyl 3-amino-5-phenylthiophene-2-carboxylate
CAS No.:
100063-22-7
M. Wt:
233.286
M. Fa:
C12H11NO2S
InChI Key:
QESSCNMSOLRYBO-UHFFFAOYSA-N
Appearance:
Gray Solid
Names and Identifiers of 100063-22-7
CAS Number |
100063-22-7 |
|---|---|
EC Number |
640-912-1 |
MDL Number |
MFCD00068161 |
IUPAC Name |
methyl 3-amino-5-phenylthiophene-2-carboxylate |
InChI |
InChI=1S/C12H11NO2S/c1-15-12(14)11-9(13)7-10(16-11)8-5-3-2-4-6-8/h2-7H,13H2,1H3 |
InChIKey |
QESSCNMSOLRYBO-UHFFFAOYSA-N |
Canonical SMILES |
COC(=O)C1=C(C=C(S1)C2=CC=CC=C2)N |
UNSPSC Code |
12352100 |
Physical and chemical properties of 100063-22-7
Acidity coefficient |
1.70±0.10(Predicted) |
|---|---|
Boiling Point |
442.5±45.0 °C at 760 mmHg |
Density |
1.3±0.1 g/cm3 |
Exact Mass |
233.051056 |
Flash Point |
221.4±28.7 °C |
Index of Refraction |
1.626 |
LogP |
3.25 |
Melting Point |
147 °C |
Molecular Formula |
C12H11NO2S |
Molecular Weight |
233.286 |
PSA |
80.56000 |
Storage condition |
2-8°C(protect from light) |
Vapour Pressure |
0.0±1.1 mmHg at 25°C |
Safety Information of 100063-22-7
Applications of 100063-22-7
Interaction Studies of 100063-22-7
Interaction studies involving methyl 3-amino-5-phenylthiophene-2-carboxylate have focused on its binding affinity to various biological targets. These studies often utilize techniques such as:
- Molecular Docking: To predict how the compound interacts with specific proteins or enzymes.
- In vitro Assays: To evaluate its efficacy against microbial strains or cancer cell lines.
Such studies are crucial for understanding the pharmacological potential of the compound and guiding further development.
Biological Activity of 100063-22-7
The biological activity of methyl 3-amino-5-phenylthiophene-2-carboxylate has been explored in various studies. It has been noted for its potential antimicrobial properties, showing effectiveness against certain bacterial strains. Additionally, the presence of the amino group suggests possible interactions with biological receptors, which could lead to therapeutic applications in treating infections or other diseases.
Physical sample testing spectrum (NMR) of 100063-22-7
