N,N-dimethyl-4,4'-bipiperidine-1-sulfonamide(SALTDATA: FREE)
Names and Identifiers of 1000958-59-7
CAS Number |
1000958-59-7 |
|---|---|
IUPAC Name |
N,N-dimethyl-4-piperidin-4-yl-piperidine-1-sulfonamide |
Canonical SMILES |
CN(C)S(=O)(=O)N1CCC(CC1)C2CCNCC2 |
Physical and chemical properties of 1000958-59-7
Exact Mass |
275.16700 |
|---|---|
LogP |
1.85190 |
Molecular Formula |
C12H25N3O2S |
Molecular Weight |
275.41100 |
PSA |
61.03000 |
Applications of 1000958-59-7
N,N-dimethyl-4,4'-bipiperidine-1-sulfonamide has various applications across multiple domains:
- Medicinal Chemistry: Potential use as an antibacterial agent or in drug design due to its structural characteristics.
- Biochemical Research: Utilized in proteomics and other biochemical assays to study protein interactions and functions.
- Forensic Science: May serve as a reagent in analytical chemistry for detecting specific compounds.
Interaction Studies of 1000958-59-7
Interaction studies involving N,N-dimethyl-4,4'-bipiperidine-1-sulfonamide focus on its binding affinity to various biological targets. Preliminary studies suggest that it may interact with enzymes involved in metabolic pathways or microbial growth inhibition. Further research is needed to elucidate specific mechanisms of action and therapeutic potentials.
Biological Activity of 1000958-59-7
Research indicates that N,N-dimethyl-4,4'-bipiperidine-1-sulfonamide exhibits biological activity that may be beneficial in pharmacological contexts. Its structure suggests potential interactions with biological targets such as enzymes and receptors. Sulfonamides are known for their antibacterial properties, and compounds with similar structures may exhibit antimicrobial activities. Additionally, the bipiperidine structure may confer psychoactive properties, warranting further exploration in neuropharmacology.
Physical sample testing spectrum (NMR) of 1000958-59-7