1,4-Piperazinediethanesulfonic acid, monosodium salt
Names and Identifiers of 10010-67-0
CAS Number |
10010-67-0 |
|---|---|
EC Number |
233-005-3 |
MDL Number |
MFCD00065472 |
IUPAC Name |
sodium;2-[4-(2-sulfoethyl)piperazin-1-yl]ethanesulfonate |
InChI |
InChI=1S/C8H18N2O6S2.Na/c11-17(12,13)7-5-9-1-2-10(4-3-9)6-8-18(14,15)16;/h1-8H2,(H,11,12,13)(H,14,15,16);/q;+1/p-1 |
InChIKey |
OGGAIRCLBMGXCZ-UHFFFAOYSA-M |
Canonical SMILES |
C1CN(CCN1CCS(=O)(=O)O)CCS(=O)(=O)[O-].[Na+] |
UNSPSC Code |
12352100 |
Physical and chemical properties of 10010-67-0
Acidity coefficient |
6.8(at 25℃) |
|---|---|
Exact Mass |
323.035309 |
LogP |
0.07440 |
Melting Point |
300 °C |
Merck |
14,7479 |
Molecular Formula |
C8H17N2NaO6S2 |
Molecular Weight |
323.343 |
pH Range |
6.1 - 7.5 |
PSA |
134.81000 |
Storage condition |
Store at RT. |
Water Solubility |
Soluble in water |
Safety Information of 10010-67-0
Applications of 10010-67-0
1,4-Piperazinediethanesulfonic acid, monosodium salt has several applications in scientific research:
- Biochemical Assays: It is extensively used in enzyme assays and protein purification processes.
- Cell Culture: PIPES serves as a buffering agent in cell culture media.
- Molecular Biology: It aids in maintaining optimal pH conditions during DNA and RNA manipulations.
- Electrophoresis: Used as a running buffer in various electrophoresis techniques.
Interaction Studies of 10010-67-0
Research has indicated that PIPES interacts favorably with various biomolecules without causing denaturation or degradation. Its unique buffering capacity allows for the stabilization of proteins and nucleic acids under varying experimental conditions. Additionally, studies have shown that PIPES can help maintain the activity of enzymes by providing an optimal pH environment during reactions.
Biological Activity of 10010-67-0
PIPES is known for its low toxicity and compatibility with biological systems, making it suitable for use in cell culture and other biological assays. It does not interfere with enzymatic reactions or cellular processes at the concentrations typically used in laboratory settings. Furthermore, studies have shown that PIPES can stabilize proteins and nucleic acids during experimental procedures, enhancing the reliability of results obtained from various assays.
Physical sample testing spectrum (NMR) of 10010-67-0
