Cyclopropanecarboxylic acid, chloromethyl ester
Names and Identifiers of 100108-45-0
CAS Number |
100108-45-0 |
|---|---|
MDL Number |
MFCD19233969 |
IUPAC Name |
chloromethyl cyclopropanecarboxylate |
InChI |
InChI=1S/C5H7ClO2/c6-3-8-5(7)4-1-2-4/h4H,1-3H2 |
InChIKey |
IXIYAEZKKVCJFK-UHFFFAOYSA-N |
Canonical SMILES |
O=C(OCCl)C1CC1 |
Physical and chemical properties of 100108-45-0
Exact Mass |
134.01300 |
|---|---|
H Bond Acceptors |
1 |
H Bond Donors |
0 |
LogP |
1.13590 |
Molecular Formula |
C5H7ClO2 |
Molecular Weight |
134.56100 |
PSA |
26.30000 |
Safety Information of 100108-45-0
Applications of 100108-45-0
Chloromethyl cyclopropanecarboxylate serves as a versatile intermediate in organic synthesis. Its unique structure allows it to be utilized in the production of various pharmaceuticals, agrochemicals, and other fine chemicals. The compound's ability to participate in substitution reactions makes it valuable for creating more complex molecular architectures.
Interaction Studies of 100108-45-0
Studies have indicated that chloromethyl cyclopropanecarboxylate interacts with various biomolecules, influencing their function. These interactions may include covalent bonding with nucleophilic sites on target molecules and participation in hydrogen bonding due to its carboxylic acid group. Such interactions are crucial for understanding the compound's biological activity and potential therapeutic applications.
Physical sample testing spectrum (NMR) of 100108-45-0

