(1-(Methoxycarbonyl)-1H-indol-2-yl)boronic acid
CAS No.:
1001162-89-5
M. Wt:
219.00200
M. Fa:
C10H10BNO4
InChI Key:
BYSPSIQMPUCCRP-UHFFFAOYSA-N
Appearance:
Pale-yellow Solid
Names and Identifiers of 1001162-89-5
CAS Number |
1001162-89-5 |
|---|---|
MDL Number |
MFCD22123264 |
IUPAC Name |
(1-methoxycarbonylindol-2-yl)boronic acid |
InChI |
InChI=1S/C10H10BNO4/c1-16-10(13)12-8-5-3-2-4-7(8)6-9(12)11(14)15/h2-6,14-15H,1H3 |
InChIKey |
BYSPSIQMPUCCRP-UHFFFAOYSA-N |
Canonical SMILES |
B(C1=CC2=CC=CC=C2N1C(=O)OC)(O)O |
UNSPSC Code |
12352100 |
Physical and chemical properties of 1001162-89-5
Acidity coefficient |
8.83±0.30(Predicted) |
|---|---|
Boiling Point |
440.6±55.0 °C(Predicted) |
Density |
1.28±0.1 g/cm3(Predicted) |
Exact Mass |
219.07000 |
H Bond Acceptors |
3 |
H Bond Donors |
2 |
LogP |
1.8347 |
Molecular Formula |
C10H10BNO4 |
Molecular Weight |
219.00200 |
PSA |
71.69000 |
Storage condition |
Inert atmosphere,Store in freezer, under -20°C |
Safety Information of 1001162-89-5
Applications of 1001162-89-5
(1-(Methoxycarbonyl)-1H-indol-2-yl)boronic acid has potential applications in:
- Pharmaceutical Development: As a building block in drug design, particularly for compounds targeting cancer and other diseases.
- Organic Synthesis: Utilized in cross-coupling reactions to synthesize complex organic molecules.
- Material Science: Investigated for use in creating functional materials due to its unique chemical properties.
Interaction Studies of 1001162-89-5
Interaction studies involving (1-(Methoxycarbonyl)-1H-indol-2-yl)boronic acid focus on its binding affinity and specificity towards biological targets. These studies typically employ techniques such as:
- Surface Plasmon Resonance (SPR): To measure real-time interactions between the compound and target proteins.
- Isothermal Titration Calorimetry (ITC): To determine thermodynamic parameters of binding interactions.
- High-throughput Screening (HTS): To evaluate biological activity against various targets in drug discovery pipelines.
Such studies are essential for understanding how modifications to the structure influence biological interactions and therapeutic potential.
Physical sample testing spectrum (NMR) of 1001162-89-5
