1-methyl-3-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole
CAS No.:
1002334-06-6
M. Wt:
284.161
M. Fa:
C16H21BN2O2
InChI Key:
NSSUPGLVAJXATA-UHFFFAOYSA-N
Appearance:
Pale-yellow Solid
Names and Identifiers of 1002334-06-6
CAS Number |
1002334-06-6 |
|---|---|
MDL Number |
MFCD16659793 |
IUPAC Name |
1-methyl-3-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
InChI |
InChI=1S/C16H21BN2O2/c1-15(2)16(3,4)21-17(20-15)13-11-19(5)18-14(13)12-9-7-6-8-10-12/h6-11H,1-5H3 |
InChIKey |
NSSUPGLVAJXATA-UHFFFAOYSA-N |
Canonical SMILES |
B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2C3=CC=CC=C3)C |
UNSPSC Code |
12352100 |
Physical and chemical properties of 1002334-06-6
Acidity coefficient |
1.56±0.10(Predicted) |
|---|---|
Boiling Point |
423.4±33.0 °C at 760 mmHg |
Density |
1.1±0.1 g/cm3 |
Exact Mass |
284.169617 |
Flash Point |
209.8±25.4 °C |
Index of Refraction |
1.543 |
LogP |
2.38630 |
Molecular Formula |
C16H21BN2O2 |
Molecular Weight |
284.161 |
PSA |
36.28000 |
Storage condition |
2-8°C |
Vapour Pressure |
0.0±1.0 mmHg at 25°C |
Safety Information of 1002334-06-6
Applications of 1002334-06-6
This compound has potential applications in various fields:
- Organic Synthesis: As a building block for synthesizing more complex molecules in pharmaceutical chemistry.
- Material Science: Potential use in developing new materials due to its unique electronic properties.
- Agricultural Chemistry: Possible applications as a pesticide or herbicide due to its biological activity.
Interaction Studies of 1002334-06-6
Interaction studies involving 1-methyl-3-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole are crucial for understanding its reactivity and potential applications. These studies typically focus on:
- Reactivity with Biological Targets: Investigating how this compound interacts with enzymes or receptors.
- Stability in Biological Systems: Assessing how the compound behaves under physiological conditions.
These interactions can provide insights into its potential therapeutic uses and safety profiles.
Physical sample testing spectrum (NMR) of 1002334-06-6
