1,3-Bis(dicyclohexylphosphino)propane bis(tetrafluoroborate)
CAS No.:
1002345-50-7
M. Wt:
610.24300
M. Fa:
C27H50B2F8P2
InChI Key:
XJZAIJGNZUQTAM-UHFFFAOYSA-P
Appearance:
White powder
Names and Identifiers of 1002345-50-7
CAS Number |
1002345-50-7 |
|---|---|
EC Number |
635-571-0 |
IUPAC Name |
dicyclohexyl(3-dicyclohexylphosphaniumylpropyl)phosphanium;ditetrafluoroborate |
InChI |
InChI=1S/C27H50P2.2BF4/c1-5-14-24(15-6-1)28(25-16-7-2-8-17-25)22-13-23-29(26-18-9-3-10-19-26)27-20-11-4-12-21-27;2*2-1(3,4)5/h24-27H,1-23H2;;/q;2*-1/p+2 |
InChIKey |
XJZAIJGNZUQTAM-UHFFFAOYSA-P |
Canonical SMILES |
[B-](F)(F)(F)F.[B-](F)(F)(F)F.C1CCC(CC1)[PH+](CCC[PH+](C2CCCCC2)C3CCCCC3)C4CCCCC4 |
Physical and chemical properties of 1002345-50-7
Exact Mass |
610.34500 |
|---|---|
LogP |
12.27110 |
Melting Point |
154-155℃ |
Molecular Formula |
C27H50B2F8P2 |
Molecular Weight |
610.24300 |
PSA |
27.18000 |
Stability |
hygroscopic |
Storage condition |
Inert atmosphere,Room Temperature |
Safety Information of 1002345-50-7
Applications of 1002345-50-7
Propane-1,3-diylbis(dicyclohexylphosphonium) tetrafluoroborate finds applications in various fields:
- Catalysis: It serves as a catalyst or co-catalyst in organic reactions.
- Electrolytes: The compound is used in ionic liquids and as an electrolyte in batteries.
- Material Science: It is employed in the development of advanced materials due to its unique chemical properties.
Interaction Studies of 1002345-50-7
Research on interaction studies involving propane-1,3-diylbis(dicyclohexylphosphonium) tetrafluoroborate primarily focuses on its reactivity with other chemical species. Its interactions with nucleophiles and electrophiles can provide insights into its potential applications in organic synthesis and material science. Additionally, studies on its solubility and stability in various solvents are essential for understanding its practical uses.
Physical sample testing spectrum (NMR) of 1002345-50-7
Cas:109-64-8
Cas:829-84-5
