tert-butyl 5-amino-1H-pyrazole-1-carboxylate
Names and Identifiers of 1003011-02-6
CAS Number |
1003011-02-6 |
|---|---|
EC Number |
820-874-4 |
MDL Number |
MFCD20702903 |
IUPAC Name |
tert-butyl 5-aminopyrazole-1-carboxylate |
InChI |
InChI=1S/C8H13N3O2/c1-8(2,3)13-7(12)11-6(9)4-5-10-11/h4-5H,9H2,1-3H3 |
InChIKey |
QYQBAJXCDXDNJU-UHFFFAOYSA-N |
Canonical SMILES |
CC(C)(C)OC(=O)N1C(=CC=N1)N |
UNSPSC Code |
12352100 |
Physical and chemical properties of 1003011-02-6
Exact Mass |
183.10100 |
|---|---|
LogP |
1.82970 |
Molecular Formula |
C8H13N3O2 |
Molecular Weight |
183.20800 |
PSA |
70.14000 |
Safety Information of 1003011-02-6
Applications of 1003011-02-6
tert-Butyl 5-amino-1H-pyrazole-1-carboxylate has several applications:
- Pharmaceutical intermediates: It serves as a precursor for synthesizing various therapeutic agents.
- Research tools: Its role as a glucokinase activator makes it valuable in metabolic research and drug discovery.
- Chemical synthesis: It is used to produce other pyrazole derivatives that may possess unique biological properties.
Interaction Studies of 1003011-02-6
Studies involving tert-butyl 5-amino-1H-pyrazole-1-carboxylate have focused on its interactions with enzymes related to glucose metabolism. Its ability to modulate glucokinase activity suggests potential interactions with other metabolic pathways, which could be explored further to understand its full pharmacological profile. These interactions are crucial for assessing its therapeutic potential in metabolic disorders such as diabetes.
Similar Compounds: ComparisonSeveral compounds share structural similarities with tert-butyl 5-amino-1H-pyrazole-1-carboxylate. Here are some notable examples:
| Compound Name | Molecular Formula | Unique Features |
|---|---|---|
| 5-Amino-3-cyclopropyl-1H-pyrazole-1-carboxylate | C9H15N3O2 | Contains a cyclopropyl group, affecting its biological activity. |
| 5-Aminopyrazole | C3H5N3 | Lacks the carboxylate functionality, limiting its applications compared to tert-butyl derivative. |
| 4-Amino-1H-pyrazole | C4H6N4 | Exhibits different reactivity due to the presence of an amino group at a different position on the ring. |
Biological Activity of 1003011-02-6
Research indicates that tert-butyl 5-amino-1H-pyrazole-1-carboxylate exhibits potential biological activities, particularly as a glucokinase activator. Glucokinase plays a crucial role in glucose metabolism, making this compound of interest for diabetes research. Additionally, it has shown promise in enhancing insulin secretion and improving glucose tolerance in preclinical studies.
Physical sample testing spectrum (NMR) of 1003011-02-6
Cas:1820-80-0
Cas:24424-99-5
