Tert-butyl (1-(3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)cyclopropyl)carbamate
Names and Identifiers of 1004294-78-3
CAS Number |
1004294-78-3 |
|---|---|
EC Number |
883-692-4 |
MDL Number |
MFCD32185347 |
IUPAC Name |
tert-butyl N-[1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropyl]carbamate |
InChI |
InChI=1S/C20H30BNO4/c1-17(2,3)24-16(23)22-20(11-12-20)14-9-8-10-15(13-14)21-25-18(4,5)19(6,7)26-21/h8-10,13H,11-12H2,1-7H3,(H,22,23) |
InChIKey |
LJHCQZRGLWDXOP-UHFFFAOYSA-N |
Canonical SMILES |
B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C3(CC3)NC(=O)OC(C)(C)C |
UNSPSC Code |
12352100 |
Physical and chemical properties of 1004294-78-3
Boiling Point |
481.8±34.0 °C(Predicted) |
|---|---|
Density |
1.09±0.1 g/cm3(Predicted) |
Exact Mass |
359.226776 |
Flash Point |
245.2±25.7 °C |
Index of Refraction |
1.523 |
Molecular Formula |
C20H30BNO4 |
Molecular Weight |
359.27 |
Storage condition |
Sealed in dry,2-8°C |
Vapour Pressure |
0.0±1.2 mmHg at 25°C |
Safety Information of 1004294-78-3
Applications of 1004294-78-3
This compound has potential applications in various fields:
- Medicinal Chemistry: It may serve as a lead compound for developing new drugs targeting specific biological pathways.
- Organic Synthesis: Its unique structure makes it a valuable intermediate in synthesizing more complex organic molecules.
- Materials Science: The incorporation of boron into polymers or other materials could enhance properties such as thermal stability or mechanical strength.
Interaction Studies of 1004294-78-3
Interaction studies are crucial for understanding how tert-butyl (1-(3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)cyclopropyl)carbamate interacts with biological targets. These studies often focus on:
- Binding Affinity: Evaluating how strongly the compound binds to specific enzymes or receptors.
- Mechanism of Action: Investigating how the compound affects biochemical pathways or cellular processes.
Preliminary data suggest that compounds with similar structures may exhibit significant interactions with neurotransmitter systems or enzymes involved in metabolic processes.
Biological Activity of 1004294-78-3
Tert-butyl (1-(3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)cyclopropyl)carbamate exhibits potential biological activity that warrants investigation. Preliminary studies suggest that compounds with similar structures may interact with enzymes or receptors involved in various biochemical pathways. The unique combination of the cyclopropyl and boron-containing groups could enhance its binding affinity to specific biological targets, making it a candidate for further pharmacological studies.
Physical sample testing spectrum (NMR) of 1004294-78-3
