2,5-Dihydrofuran-3-carboxylic acid
CAS No.:
1002728-73-5
M. Wt:
114.09900
M. Fa:
C5H6O3
InChI Key:
VGPHHRYBFDWNMV-UHFFFAOYSA-N
Appearance:
Pale-yellow Solid
Names and Identifiers of 2,5-Dihydrofuran-3-carboxylic acid
CAS Number |
1002728-73-5 |
|---|---|
IUPAC Name |
2,5-dihydrofuran-3-carboxylic acid |
InChI |
InChI=1S/C5H6O3/c6-5(7)4-1-2-8-3-4/h1H,2-3H2,(H,6,7) |
InChIKey |
VGPHHRYBFDWNMV-UHFFFAOYSA-N |
Canonical SMILES |
C1C=C(CO1)C(=O)O |
Physical and chemical properties of 2,5-Dihydrofuran-3-carboxylic acid
Exact Mass |
114.03200 |
|---|---|
LogP |
0.02760 |
Molecular Formula |
C5H6O3 |
Molecular Weight |
114.09900 |
PSA |
46.53000 |
Safety Information of 2,5-Dihydrofuran-3-carboxylic acid
Applications of 2,5-Dihydrofuran-3-carboxylic acid
2,5-Dihydrofuran-3-carboxylic acid has potential applications in:
- Pharmaceuticals: As a building block for synthesizing biologically active compounds.
- Organic Synthesis: Used in the preparation of more complex molecules due to its reactive functional groups.
- Materials Science: Potential use in developing novel materials due to its unique chemical properties.
Interaction Studies of 2,5-Dihydrofuran-3-carboxylic acid
Research on interaction studies involving 2,5-dihydrofuran-3-carboxylic acid focuses on its derivatives and their behavior in biological systems. For example, studies have shown that derivatives can interact with other biomolecules, leading to interesting biochemical pathways and effects. Understanding these interactions can help elucidate the mechanisms behind their biological activities.
Physical sample testing spectrum (NMR) of 2,5-Dihydrofuran-3-carboxylic acid
Cas:797038-34-7
