2-(3-Methoxypyridin-2-YL)acetic acid
Names and Identifiers of 2-(3-Methoxypyridin-2-YL)acetic acid
CAS Number |
1000515-98-9 |
|---|---|
MDL Number |
MFCD09924953 |
IUPAC Name |
2-(3-methoxypyridin-2-yl)acetic acid |
InChI |
InChI=1S/C8H9NO3/c1-12-7-3-2-4-9-6(7)5-8(10)11/h2-4H,5H2,1H3,(H,10,11) |
InChIKey |
OPKXCVNZKVPQFE-UHFFFAOYSA-N |
Canonical SMILES |
COC1=C(N=CC=C1)CC(=O)O |
UNSPSC Code |
12352100 |
Physical and chemical properties of 2-(3-Methoxypyridin-2-YL)acetic acid
Exact Mass |
167.05800 |
|---|---|
LogP |
0.71730 |
Molecular Formula |
C8H9NO3 |
Molecular Weight |
167.16200 |
PSA |
59.42000 |
Safety Information of 2-(3-Methoxypyridin-2-YL)acetic acid
Applications of 2-(3-Methoxypyridin-2-YL)acetic acid
2-(3-Methoxypyridin-2-YL)acetic acid has several applications:
- Pharmaceuticals: It serves as a building block in the synthesis of bioactive compounds, particularly in drug discovery for antibacterial agents.
- Agricultural Chemistry: Its derivatives may be explored for use as herbicides or fungicides due to their biological activity.
- Chemical Research: Used as an intermediate in organic synthesis, particularly in the development of new materials and functionalized compounds.
Interaction Studies of 2-(3-Methoxypyridin-2-YL)acetic acid
Interaction studies of 2-(3-Methoxypyridin-2-YL)acetic acid focus on its binding affinity with various biological targets. Molecular docking studies suggest that it interacts effectively with certain enzymes and receptors, indicating potential therapeutic uses. These interactions are often analyzed through computational methods to predict pharmacokinetic properties and optimize lead compounds for drug development.
Biological Activity of 2-(3-Methoxypyridin-2-YL)acetic acid
Studies indicate that 2-(3-Methoxypyridin-2-YL)acetic acid exhibits various biological activities. It has been investigated for its potential as an antibacterial agent, with some derivatives showing significant efficacy against specific bacterial strains. The presence of the methoxy and pyridine groups contributes to its interaction with biological targets, making it a candidate for further pharmacological studies.
Physical sample testing spectrum (NMR) of 2-(3-Methoxypyridin-2-YL)acetic acid
