2-Amino-4-chlorobenzenethiol
Names and Identifiers of 2-Amino-4-chlorobenzenethiol
CAS Number |
1004-00-8 |
|---|---|
EC Number |
628-965-9 |
IUPAC Name |
2-amino-4-chlorobenzenethiol |
InChI |
InChI=1S/C6H6ClNS/c7-4-1-2-6(9)5(8)3-4/h1-3,9H,8H2 |
InChIKey |
NGIRMPARLVGMPX-UHFFFAOYSA-N |
Canonical SMILES |
C1=CC(=C(C=C1Cl)N)S |
Physical and chemical properties of 2-Amino-4-chlorobenzenethiol
Acidity coefficient |
7.35±0.11(Predicted) |
|---|---|
Boiling Point |
281.2±20.0 °C at 760 mmHg |
Density |
1.4±0.1 g/cm3 |
Exact Mass |
158.990952 |
Flash Point |
123.9±21.8 °C |
H Bond Acceptors |
1 |
H Bond Donors |
2 |
Index of Refraction |
1.672 |
LogP |
2.55 |
Melting Point |
56-61 °C(lit.) |
Molecular Formula |
C6H6ClNS |
Molecular Weight |
159.637 |
PSA |
64.82000 |
Sensitivity |
Stench |
Storage condition |
Keep in dark place,Inert atmosphere,Room temperature |
Vapour Pressure |
0.0±0.6 mmHg at 25°C |
Water Solubility |
Practically insoluble in water |
Safety Information of 2-Amino-4-chlorobenzenethiol
Applications of 2-Amino-4-chlorobenzenethiol
2-Amino-4-chlorobenzenethiol finds applications in various fields:
- Pharmaceuticals: It is used as an intermediate in the synthesis of pharmaceutical compounds due to its reactive thiol and amino groups.
- Analytical Chemistry: The compound is utilized in assays for metal ions due to its ability to form colored complexes.
- Material Science: Its properties are explored in the development of novel materials and coatings that require specific chemical reactivity.
Interaction Studies of 2-Amino-4-chlorobenzenethiol
Studies on the interactions of 2-amino-4-chlorobenzenethiol have focused on its reactivity with metal ions and other organic compounds. Its ability to form complexes with transition metals suggests potential applications in catalysis and sensor technologies. Furthermore, research into its antioxidant properties highlights its potential role in biological systems as a protective agent against oxidative stress.
Biological Activity of 2-Amino-4-chlorobenzenethiol
Research indicates that 2-amino-4-chlorobenzenethiol exhibits notable biological activities. It has been studied for its potential as an antioxidant and anti-inflammatory agent. The compound forms a green precipitate with molybdenum (VI) at acidic pH, suggesting possible applications in analytical chemistry for detecting certain metal ions. Furthermore, its structure allows it to interact with various biological targets, although specific mechanisms of action are still under investigation.
Physical sample testing spectrum (NMR) of 2-Amino-4-chlorobenzenethiol
Cas:29124-55-8
Cas:36776-27-9
Cas:20358-00-3