2-Chloropyridine-4-sulfonyl chloride
Names and Identifiers of 2-Chloropyridine-4-sulfonyl chloride
CAS Number |
1000933-25-4 |
|---|---|
MDL Number |
MFCD09971485 |
IUPAC Name |
2-chloropyridine-4-sulfonyl chloride |
InChI |
InChI=1S/C5H3Cl2NO2S/c6-5-3-4(1-2-8-5)11(7,9)10/h1-3H |
InChIKey |
YQKSHKJJXUAFAN-UHFFFAOYSA-N |
Canonical SMILES |
C1=CN=C(C=C1S(=O)(=O)Cl)Cl |
UNSPSC Code |
12352100 |
Physical and chemical properties of 2-Chloropyridine-4-sulfonyl chloride
Boiling Point |
329.4±27.0 °C at 760 mmHg |
|---|---|
Density |
1.6±0.1 g/cm3 |
Exact Mass |
210.926147 |
Flash Point |
153.0±23.7 °C |
H Bond Acceptors |
3 |
H Bond Donors |
0 |
Index of Refraction |
1.569 |
LogP |
1.53 |
Molecular Formula |
C5H3Cl2NO2S |
Molecular Weight |
212.054 |
PSA |
55.41000 |
Vapour Pressure |
0.0±0.7 mmHg at 25°C |
Safety Information of 2-Chloropyridine-4-sulfonyl chloride
Applications of 2-Chloropyridine-4-sulfonyl chloride
2-Chloropyridine-4-sulfonyl chloride finds applications across various fields:
- Medicinal Chemistry: It serves as an intermediate in the synthesis of pharmaceuticals, particularly those targeting specific biological pathways.
- Material Science: Used in developing polymeric materials with tailored properties through functionalization reactions.
- Biochemical Research: Its ability to modify proteins makes it valuable in proteomics and biochemical assays.
Interaction Studies of 2-Chloropyridine-4-sulfonyl chloride
Interaction studies involving 2-Chloropyridine-4-sulfonyl chloride focus on its reactivity with different nucleophiles and its effects on biological systems. Research indicates that its sulfonyl chloride group can significantly alter the properties of target molecules, affecting their biological activity and stability. Such studies are crucial for understanding how modifications influence drug efficacy and safety.
Biological Activity of 2-Chloropyridine-4-sulfonyl chloride
2-Chloropyridine-4-sulfonyl chloride exhibits biological activity that makes it relevant in pharmaceutical research. It has been studied for its potential as an inhibitor in various biological pathways. For instance, it has shown promise in proteomics research, where it is utilized to modify proteins and peptides for further analysis. Its reactivity allows for selective modifications that can elucidate biological functions and interactions.
Physical sample testing spectrum (NMR) of 2-Chloropyridine-4-sulfonyl chloride
Cas:73583-37-6
Cas:14432-12-3