2-Fluoro-5-methoxy-4-nitrobenzoic acid
Names and Identifiers of 2-Fluoro-5-methoxy-4-nitrobenzoic acid
CAS Number |
1001345-80-7 |
|---|---|
EC Number |
810-319-4 |
MDL Number |
MFCD26395470 |
IUPAC Name |
2-fluoro-5-methoxy-4-nitrobenzoic acid |
InChI |
InChI=1S/C8H6FNO5/c1-15-7-2-4(8(11)12)5(9)3-6(7)10(13)14/h2-3H,1H3,(H,11,12) |
InChIKey |
JXCYBTVSPGQRCM-UHFFFAOYSA-N |
Canonical SMILES |
COC1=C(C=C(C(=C1)C(=O)O)F)[N+](=O)[O-] |
UNSPSC Code |
12352100 |
Physical and chemical properties of 2-Fluoro-5-methoxy-4-nitrobenzoic acid
Exact Mass |
215.02300 |
|---|---|
H Bond Acceptors |
5 |
H Bond Donors |
1 |
LogP |
1.96390 |
Molecular Formula |
C8H6FNO5 |
Molecular Weight |
215.13500 |
PSA |
92.35000 |
Safety Information of 2-Fluoro-5-methoxy-4-nitrobenzoic acid
Applications of 2-Fluoro-5-methoxy-4-nitrobenzoic acid
The applications of 2-fluoro-5-methoxy-4-nitrobenzoic acid span various fields:
- Pharmaceuticals: It serves as an intermediate in synthesizing drugs due to its biological activity and ability to form diverse derivatives.
- Material Science: The compound's unique electronic properties make it suitable for developing new materials, especially in organic electronics and photonics.
- Chemical Synthesis: It acts as a building block for more complex organic molecules used in various chemical industries.
Interaction Studies of 2-Fluoro-5-methoxy-4-nitrobenzoic acid
Interaction studies involving 2-fluoro-5-methoxy-4-nitrobenzoic acid focus on its binding affinity and reactivity with various biological targets. Preliminary studies suggest potential interactions with enzymes or receptors that could lead to therapeutic effects. Further research is necessary to elucidate these interactions fully, which may pave the way for novel drug development strategies.
Biological Activity of 2-Fluoro-5-methoxy-4-nitrobenzoic acid
Research indicates that 2-fluoro-5-methoxy-4-nitrobenzoic acid exhibits biological activity, particularly in antimicrobial and anti-inflammatory contexts. Its structural features may contribute to its ability to interact with biological targets, although specific mechanisms remain under investigation. The presence of the nitro group is often associated with enhanced biological activity, making this compound a candidate for further pharmacological studies.
Physical sample testing spectrum (NMR) of 2-Fluoro-5-methoxy-4-nitrobenzoic acid
Cas:924868-81-5
